The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzyloxycarbonylamino-3-{2-[(S)-4-(2-guanidino-ethyl)-2,5-dioxo-imidazolidin-1-yl]-acetylamino}-propionic acid anion ID: ALA1160222
PubChem CID: 44296742
Max Phase: Preclinical
Molecular Formula: C19H25N7O7
Molecular Weight: 463.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCC[C@@H]1NC(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C1=O
Standard InChI: InChI=1S/C19H25N7O7/c20-17(21)22-7-6-12-15(28)26(18(31)24-12)9-14(27)23-8-13(16(29)30)25-19(32)33-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,23,27)(H,24,31)(H,25,32)(H,29,30)(H4,20,21,22)/t12-,13?/m0/s1
Standard InChI Key: MIKCNEPEXKKSOM-UEWDXFNNSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
4.0417 -0.7792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7875 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3750 -0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9625 -1.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7125 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6250 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2375 -1.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1875 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2750 -2.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1875 -2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3750 0.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2250 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8375 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5750 -0.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1917 -0.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1750 0.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6375 -1.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2667 -1.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5250 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9083 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 -0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4250 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3125 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0375 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8625 -3.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8125 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4250 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4750 -3.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2625 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 17 1 0
7 9 1 0
8 6 1 0
9 6 1 0
10 1 1 0
11 23 1 0
12 10 1 0
13 2 2 0
14 11 2 0
15 3 2 0
16 12 1 0
17 16 1 0
18 8 1 0
19 7 2 0
20 8 2 0
21 7 1 0
22 12 2 0
23 27 1 0
24 11 1 0
5 25 1 1
26 21 1 0
27 25 1 0
28 26 1 0
29 28 2 0
30 28 1 0
31 30 2 0
32 29 1 0
33 31 1 0
5 4 1 0
32 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.45Molecular Weight (Monoisotopic): 463.1815AlogP: -1.72#Rotatable Bonds: 11Polar Surface Area: 216.04Molecular Species: ZWITTERIONHBA: 7HBD: 7#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.42CX Basic pKa: 12.17CX LogP: -3.78CX LogD: -3.78Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.11Np Likeness Score: -0.58
References 1. Peyman A, Wehner V, Knolle J, Stilz HU, Breipohl G, Scheunemann KH, Carniato D, Ruxer JM, Gourvest JF, Gadek TR, Bodary S.. (2000) RGD mimetics containing a central hydantoin scaffold: alpkha(v)beta3 vs alpha(IIb)beta3 selectivity requirements., 10 (2): [PMID:10673106 ] [10.1016/s0960-894x(99)00661-7 ]