3-[2-((S)-4-{[(1H-Benzoimidazol-2-ylmethyl)-carbamoyl]-methyl}-2,5-dioxo-imidazolidin-1-yl)-acetylamino]-2-benzyloxycarbonylamino-propionic acid anion

ID: ALA1160227

PubChem CID: 44296866

Max Phase: Preclinical

Molecular Formula: C26H27N7O8

Molecular Weight: 565.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(C[C@@H]1NC(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C1=O)NCc1nc2ccccc2[nH]1

Standard InChI:  InChI=1S/C26H27N7O8/c34-21(28-12-20-29-16-8-4-5-9-17(16)30-20)10-18-23(36)33(25(39)31-18)13-22(35)27-11-19(24(37)38)32-26(40)41-14-15-6-2-1-3-7-15/h1-9,18-19H,10-14H2,(H,27,35)(H,28,34)(H,29,30)(H,31,39)(H,32,40)(H,37,38)/t18-,19?/m0/s1

Standard InChI Key:  QUXWWWADVUUFKU-OYKVQYDMSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
    3.9500   -1.1875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7000   -1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2875   -0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -1.9750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -1.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9750   -0.5417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8875   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6458   -1.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5292   -1.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9292   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7000   -0.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1500   -2.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7375   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2000   -1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2167   -1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3500   -1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1792   -2.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2792    0.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375   -1.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7500   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -1.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4875   -0.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1000   -1.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0875   -0.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5417   -2.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -2.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -2.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1750   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3292   -2.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9417   -2.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1958    0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0125   -1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7667   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7250   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0208    0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4333   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3375   -2.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3875   -4.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1667   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6  7  2  0
  7 30  1  0
  8  7  1  0
  9 22  1  0
  5 10  1  1
 11 13  1  0
 12  9  1  0
 13  9  1  0
 14  1  1  0
 15  6  1  0
 16  8  1  0
 17 10  1  0
 18 14  1  0
 19  2  2  0
 20  3  2  0
 21 18  1  0
 22 21  1  0
 23 17  1  0
 24 12  1  0
 25 11  2  0
 26 12  2  0
 27 11  1  0
 28 17  2  0
 29 18  2  0
 30 23  1  0
 31 27  1  0
 32 31  1  0
 33 15  1  0
 34 16  1  0
 35 32  2  0
 36 32  1  0
 37 33  2  0
 38 34  2  0
 39 36  2  0
 40 35  1  0
 41 39  1  0
  5  4  1  0
 16 15  2  0
 37 38  1  0
 40 41  2  0
M  END

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-IIb/beta-3 (3481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 565.54Molecular Weight (Monoisotopic): 565.1921AlogP: -0.01#Rotatable Bonds: 12
Polar Surface Area: 211.92Molecular Species: ACIDHBA: 8HBD: 6
#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.41CX Basic pKa: 5.05CX LogP: -2.25CX LogD: -4.15
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -1.10

References

1. Peyman A, Wehner V, Knolle J, Stilz HU, Breipohl G, Scheunemann KH, Carniato D, Ruxer JM, Gourvest JF, Gadek TR, Bodary S..  (2000)  RGD mimetics containing a central hydantoin scaffold: alpkha(v)beta3 vs alpha(IIb)beta3 selectivity requirements.,  10  (2): [PMID:10673106] [10.1016/s0960-894x(99)00661-7]

Source