The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[4-((S)-2-Carboxy-2-{[(S)-1-(3,5-dichloro-benzenesulfonyl)-2-methyl-pyrrolidine-2-carbonyl]-amino}-ethyl)-phenylcarbamoyl]-3-methylsulfanyl-pyridinium ID: ALA1160252
PubChem CID: 44299090
Max Phase: Preclinical
Molecular Formula: C28H28Cl2N4O6S2
Molecular Weight: 651.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1cnccc1C(=O)Nc1ccc(C[C@H](NC(=O)[C@]2(C)CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1
Standard InChI: InChI=1S/C28H28Cl2N4O6S2/c1-28(9-3-11-34(28)42(39,40)21-14-18(29)13-19(30)15-21)27(38)33-23(26(36)37)12-17-4-6-20(7-5-17)32-25(35)22-8-10-31-16-24(22)41-2/h4-8,10,13-16,23H,3,9,11-12H2,1-2H3,(H,32,35)(H,33,38)(H,36,37)/t23-,28-/m0/s1
Standard InChI Key: UNKOTAZGQDRZGB-FIPFOOKPSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
1.9917 -1.9042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9917 -1.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4042 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3542 -0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3542 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0667 -0.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5042 -4.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6417 -3.4625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 -3.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -2.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -1.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0667 -4.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3542 -1.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0167 -2.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0292 -3.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3542 -2.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 0.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -3.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3167 -0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3667 0.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 -2.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3542 -4.6875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2167 -0.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7917 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -4.6625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.7833 -2.6292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7792 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4917 -3.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2167 -3.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2167 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 -3.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 0.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3500 -5.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 0
3 5 1 1
6 11 1 0
7 6 1 0
8 5 1 0
9 8 1 0
10 36 1 0
11 25 1 0
12 9 1 0
13 4 2 0
14 4 1 0
15 1 2 0
16 1 2 0
17 7 2 0
18 5 2 0
19 13 1 0
20 14 2 0
21 6 2 0
22 20 1 0
9 23 1 6
24 12 2 0
25 38 2 0
26 2 1 0
27 3 1 0
3 28 1 6
29 23 1 0
30 17 1 0
31 12 1 0
32 17 1 0
33 20 1 0
34 19 1 0
35 7 1 0
36 35 2 0
37 39 2 0
38 40 1 0
39 29 1 0
40 29 2 0
41 26 1 0
42 30 1 0
27 41 1 0
19 22 2 0
37 25 1 0
32 10 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 651.59Molecular Weight (Monoisotopic): 650.0827AlogP: 4.72#Rotatable Bonds: 10Polar Surface Area: 145.77Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.08CX Basic pKa: 1.81CX LogP: 4.15CX LogD: 0.92Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -1.01
References 1. Doherty GA, Yang GX, Borges E, Tong S, McCauley ED, Treonz KM, Van Riper G, Pacholok S, Si Q, Koo GC, Shah K, Mumford RA, Hagmann WK.. (2003) N-isonicotinoyl-(L)-4-aminophenylalanine derivatives as tight binding VLA-4 antagonists., 13 (11): [PMID:12749892 ] [10.1016/s0960-894x(03)00308-1 ]