4-[4-((S)-2-Carboxy-2-{[(S)-1-(3,5-dichloro-benzenesulfonyl)-2-methyl-pyrrolidine-2-carbonyl]-amino}-ethyl)-phenylcarbamoyl]-3-methylsulfanyl-pyridinium

ID: ALA1160252

PubChem CID: 44299090

Max Phase: Preclinical

Molecular Formula: C28H28Cl2N4O6S2

Molecular Weight: 651.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSc1cnccc1C(=O)Nc1ccc(C[C@H](NC(=O)[C@]2(C)CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1

Standard InChI:  InChI=1S/C28H28Cl2N4O6S2/c1-28(9-3-11-34(28)42(39,40)21-14-18(29)13-19(30)15-21)27(38)33-23(26(36)37)12-17-4-6-20(7-5-17)32-25(35)22-8-10-31-16-24(22)41-2/h4-8,10,13-16,23H,3,9,11-12H2,1-2H3,(H,32,35)(H,33,38)(H,36,37)/t23-,28-/m0/s1

Standard InChI Key:  UNKOTAZGQDRZGB-FIPFOOKPSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
    1.9917   -1.9042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -1.0792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6417   -0.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3542   -0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3542   -3.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0792   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667   -0.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5042   -4.2792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6417   -3.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -0.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6042   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -3.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5792   -2.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -1.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0667   -4.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3542   -1.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0292   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3542   -2.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2292   -3.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -1.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042    0.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9292   -3.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3167   -0.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667    0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292    0.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -2.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3542   -4.6875    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -0.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7917   -4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2417   -4.6625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.7833   -2.6292    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.7792   -3.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4917   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9292   -2.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -3.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3500   -5.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  3  5  1  1
  6 11  1  0
  7  6  1  0
  8  5  1  0
  9  8  1  0
 10 36  1  0
 11 25  1  0
 12  9  1  0
 13  4  2  0
 14  4  1  0
 15  1  2  0
 16  1  2  0
 17  7  2  0
 18  5  2  0
 19 13  1  0
 20 14  2  0
 21  6  2  0
 22 20  1  0
  9 23  1  6
 24 12  2  0
 25 38  2  0
 26  2  1  0
 27  3  1  0
  3 28  1  6
 29 23  1  0
 30 17  1  0
 31 12  1  0
 32 17  1  0
 33 20  1  0
 34 19  1  0
 35  7  1  0
 36 35  2  0
 37 39  2  0
 38 40  1  0
 39 29  1  0
 40 29  2  0
 41 26  1  0
 42 30  1  0
 27 41  1  0
 19 22  2  0
 37 25  1  0
 32 10  2  0
M  END

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-4/beta-1 (2269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 651.59Molecular Weight (Monoisotopic): 650.0827AlogP: 4.72#Rotatable Bonds: 10
Polar Surface Area: 145.77Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.08CX Basic pKa: 1.81CX LogP: 4.15CX LogD: 0.92
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -1.01

References

1. Doherty GA, Yang GX, Borges E, Tong S, McCauley ED, Treonz KM, Van Riper G, Pacholok S, Si Q, Koo GC, Shah K, Mumford RA, Hagmann WK..  (2003)  N-isonicotinoyl-(L)-4-aminophenylalanine derivatives as tight binding VLA-4 antagonists.,  13  (11): [PMID:12749892] [10.1016/s0960-894x(03)00308-1]

Source