The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[4-(4-Chloro-phenyl)-4-hydroxy-piperidin-1-yl]-1-(4-fluoro-phenyl)-butan-1-one;propionate HCl ID: ALA1160253
PubChem CID: 46905356
Max Phase: Preclinical
Molecular Formula: C24H29ClFNO4
Molecular Weight: 375.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)O.O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1
Standard InChI: InChI=1S/C21H23ClFNO2.C3H6O2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16;1-2-3(4)5/h3-10,26H,1-2,11-15H2;2H2,1H3,(H,4,5)
Standard InChI Key: OWKDVFWTVSYAHW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
17.5292 -7.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0417 -6.6125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0875 -8.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5167 -7.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0042 -8.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3750 -10.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3750 -8.1625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2500 -9.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4667 -9.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1792 -10.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5792 -5.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6917 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5917 -4.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4792 -8.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2500 -8.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2125 -10.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1792 -11.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -5.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6917 -6.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5042 -10.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0167 -12.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8917 -6.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8750 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -7.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0167 -10.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0542 -12.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 -7.1625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8917 -12.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.3750 -7.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4667 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4667 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 1 0
5 4 1 0
7 14 1 0
8 6 1 0
9 6 1 0
10 6 1 0
11 31 1 0
12 11 1 0
13 11 2 0
14 9 1 0
15 8 1 0
16 10 2 0
17 10 1 0
18 12 1 0
19 12 2 0
20 6 1 0
21 26 1 0
22 24 2 0
23 18 2 0
24 19 1 0
25 16 1 0
26 17 2 0
27 22 1 0
28 21 1 0
29 7 1 0
30 29 1 0
31 30 1 0
7 15 1 0
25 21 2 0
23 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 375.87Molecular Weight (Monoisotopic): 375.1401AlogP: 4.43#Rotatable Bonds: 6Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.96CX Basic pKa: 8.05CX LogP: 3.66CX LogD: 2.93Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.76Np Likeness Score: -0.94
References 1. Iorio MA, Reymer TP, Frigeni V.. (1987) Combined analgesic/neuroleptic activity in N-butyrophenone prodine-like compounds., 30 (10): [PMID:2888899 ] [10.1021/jm00393a037 ]