The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E)-4-(3-benzoylphenoxy)-3-methylbut-2-enyl trihydrogen diphosphate ID: ALA1160277
PubChem CID: 44302034
Max Phase: Preclinical
Molecular Formula: C18H20O9P2
Molecular Weight: 442.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\COP(=O)(O)OP(=O)(O)O)COc1cccc(C(=O)c2ccccc2)c1
Standard InChI: InChI=1S/C18H20O9P2/c1-14(10-11-26-29(23,24)27-28(20,21)22)13-25-17-9-5-8-16(12-17)18(19)15-6-3-2-4-7-15/h2-10,12H,11,13H2,1H3,(H,23,24)(H2,20,21,22)/b14-10+
Standard InChI Key: PDIWSWUTUXPEGR-GXDHUFHOSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
10.9917 -2.9042 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.6917 -3.0792 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.4042 -3.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -3.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7042 -3.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4000 -2.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9042 -2.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7667 -2.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1042 -2.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -2.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9667 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -3.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1125 -3.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6792 -3.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5375 -3.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8250 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -3.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 -3.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1125 -4.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -3.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -4.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -3.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -4.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -4.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 5 1 0
5 11 1 0
6 1 1 0
7 1 1 0
8 2 1 0
9 1 2 0
10 2 2 0
11 18 2 0
12 4 2 0
13 16 2 0
14 4 1 0
15 2 1 0
16 20 1 0
17 19 1 0
18 17 1 0
19 13 1 0
20 15 1 0
21 22 1 0
22 26 2 0
23 13 1 0
24 14 2 0
25 14 1 0
26 18 1 0
27 24 1 0
28 25 2 0
29 28 1 0
21 5 2 0
29 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.30Molecular Weight (Monoisotopic): 442.0583AlogP: 3.47#Rotatable Bonds: 10Polar Surface Area: 139.59Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.77CX Basic pKa: ┄CX LogP: 2.81CX LogD: -2.22Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: 0.50
References 1. Marecak DM, Horiuchi Y, Arai H, Shimonaga M, Maki Y, Koyama T, Ogura K, Prestwich GD. (1997) Benzoylphenoxy analogs of isoprenoid diphosphates as photoactivatable substrates for bacterial prenyltransferases, 7 (15): [10.1016/S0960-894X(97)00342-9 ]