The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzoylphenoxy analogue ID: ALA1160285
PubChem CID: 10324054
Max Phase: Preclinical
Molecular Formula: C23H28O9P2
Molecular Weight: 510.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)COc1cccc(C(=O)c2ccccc2)c1
Standard InChI: InChI=1S/C23H28O9P2/c1-18(14-15-31-34(28,29)32-33(25,26)27)8-6-9-19(2)17-30-22-13-7-12-21(16-22)23(24)20-10-4-3-5-11-20/h3-5,7,9-14,16H,6,8,15,17H2,1-2H3,(H,28,29)(H2,25,26,27)/b18-14+,19-9+
Standard InChI Key: ALCZOXVCEVZROP-KKEAHIQDSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
14.1042 -3.1125 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
12.8042 -3.2875 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.5167 -3.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -3.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5250 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8167 -3.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5125 -2.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0167 -2.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8875 -2.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2167 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0917 -3.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9500 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8042 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6667 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6625 -3.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9500 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3792 -3.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3792 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -4.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -4.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2375 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0875 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9417 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -4.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9542 -4.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -4.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -4.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 5 1 0
5 11 1 0
6 1 1 0
7 1 1 0
8 2 1 0
9 1 2 0
10 2 2 0
11 20 2 0
12 4 2 0
13 17 2 0
14 4 1 0
15 2 1 0
16 18 2 0
17 23 1 0
18 22 1 0
19 21 1 0
20 19 1 0
21 13 1 0
22 15 1 0
23 26 1 0
24 25 1 0
25 31 2 0
26 16 1 0
27 13 1 0
28 16 1 0
29 14 1 0
30 14 2 0
31 20 1 0
32 29 2 0
33 30 1 0
34 33 2 0
24 5 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.42Molecular Weight (Monoisotopic): 510.1209AlogP: 5.20#Rotatable Bonds: 13Polar Surface Area: 139.59Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.77CX Basic pKa: ┄CX LogP: 4.47CX LogD: -0.56Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: 0.80
References 1. Marecak DM, Horiuchi Y, Arai H, Shimonaga M, Maki Y, Koyama T, Ogura K, Prestwich GD. (1997) Benzoylphenoxy analogs of isoprenoid diphosphates as photoactivatable substrates for bacterial prenyltransferases, 7 (15): [10.1016/S0960-894X(97)00342-9 ]