Phosphoric acid mono-[4-(3-acetyl-4-cyclohexylmethoxy-benzylcarbamoyl)-phenyl] ester

ID: ALA1160317

PubChem CID: 44305333

Max Phase: Preclinical

Molecular Formula: C23H28NO7P

Molecular Weight: 461.45

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)c1cc(CNC(=O)c2ccc(OP(=O)(O)O)cc2)ccc1OCC1CCCCC1

Standard InChI:  InChI=1S/C23H28NO7P/c1-16(25)21-13-18(7-12-22(21)30-15-17-5-3-2-4-6-17)14-24-23(26)19-8-10-20(11-9-19)31-32(27,28)29/h7-13,17H,2-6,14-15H2,1H3,(H,24,26)(H2,27,28,29)

Standard InChI Key:  XSBRNOXAUJFSRN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    0.1875   -2.7000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.6042   -2.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -3.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4750   -3.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6042   -1.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1875   -1.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6125   -2.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9042   -2.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0500   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1792   -3.5250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9000   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0292   -2.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -4.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -0.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0500   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -3.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9000   -3.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1875   -3.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7417   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6042   -3.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -2.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4542   -2.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042   -1.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1667   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4542   -1.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1667   -1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8792   -2.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8792   -1.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 12  2  0
  3 10  1  0
  4  3  1  0
  5 16  2  0
  6  2  1  0
  1  7  1  0
  1  8  1  0
  9  1  1  0
 10 18  2  0
 11  1  2  0
 12 19  1  0
 13  5  1  0
 14  3  2  0
 15  6  2  0
 16 23  1  0
 17 24  2  0
 18 25  1  0
 19 21  1  0
 20  9  1  0
 21  4  1  0
 22 13  1  0
 23 19  2  0
 24 20  1  0
 25 20  2  0
 26 22  1  0
 27  6  1  0
 28 26  1  0
 29 26  1  0
 30 29  1  0
 31 28  1  0
 32 30  1  0
 17 10  1  0
  5  2  1  0
 31 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1160317

   [4-[[3-Acetyl-4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl] dihydrogen phosphate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 461.45

Molecular Weight (Monoisotopic): 461.1603

AlogP: 4.25

#Rotatable Bonds: 9

Polar Surface Area: 122.16

Molecular Species: ACID

HBA: 5

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 1.78

CX Basic pKa: ┄

CX LogP: 3.33

CX LogD: 0.22

Aromatic Rings: 2

Heavy Atoms: 32

QED Weighted: 0.38

Np Likeness Score: -0.51

References

1. Price DJ, Jorgensen WL..  (2000)  Computational binding studies of human pp60c-src SH2 domain with a series of nonpeptide, phosphophenyl-containing ligands.,  10  (18): [PMID:10999472] [10.1016/s0960-894x(00)00401-7]

Source

Source(1):

• Scientific Literature