The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{3-[3'-(2-Carboxy-1-phenyl-ethylsulfamoyl)-biphenyl-3-yl]-ureido}-3H-benzoimidazol-1-ium ID: ALA1160320
PubChem CID: 21982435
Max Phase: Preclinical
Molecular Formula: C29H25N5O5S
Molecular Weight: 555.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(NS(=O)(=O)c1cccc(-c2cccc(NC(=O)Nc3nc4ccccc4[nH]3)c2)c1)c1ccccc1
Standard InChI: InChI=1S/C29H25N5O5S/c35-27(36)18-26(19-8-2-1-3-9-19)34-40(38,39)23-13-7-11-21(17-23)20-10-6-12-22(16-20)30-29(37)33-28-31-24-14-4-5-15-25(24)32-28/h1-17,26,34H,18H2,(H,35,36)(H3,30,31,32,33,37)
Standard InChI Key: JNSBZXVASWNXFL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
8.6417 -1.8167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5000 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6917 -2.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -1.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -2.2292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9250 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9792 -3.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0667 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3417 -2.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0667 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6417 -2.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -1.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2125 -1.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7875 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -2.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -4.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7792 -4.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7875 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2000 -0.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8250 -3.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4333 -2.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6417 -4.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9250 -3.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -4.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5833 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2125 -3.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9292 -4.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2125 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 2 2 0
4 7 1 0
5 2 1 0
6 1 1 0
7 16 1 0
8 1 1 0
9 3 1 0
10 11 1 0
11 6 1 0
12 5 1 0
13 10 1 0
14 1 2 0
15 1 2 0
16 22 1 0
17 8 1 0
18 17 2 0
19 18 1 0
20 7 2 0
21 19 2 0
22 21 1 0
23 13 2 0
24 11 1 0
25 13 1 0
26 8 2 0
27 29 2 0
28 19 1 0
29 26 1 0
30 9 2 0
31 28 2 0
32 12 2 0
33 31 1 0
34 24 1 0
35 24 2 0
36 30 1 0
37 32 1 0
38 35 1 0
39 34 2 0
40 38 2 0
18 27 1 0
40 39 1 0
33 22 2 0
9 12 1 0
36 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.62Molecular Weight (Monoisotopic): 555.1576AlogP: 5.37#Rotatable Bonds: 9Polar Surface Area: 153.28Molecular Species: ACIDHBA: 5HBD: 5#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.84CX Basic pKa: 2.40CX LogP: 4.91CX LogD: 1.75Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -1.26
References 1. Urbahns K, Härter M, Albers M, Schmidt D, Stelte-Ludwig B, Brüggemeier U, Vaupel A, Gerdes C.. (2002) Biphenyls as potent vitronectin receptor antagonists., 12 (2): [PMID:11755355 ] [10.1016/s0960-894x(01)00717-x ]