2-{3-[3'-(2-Carboxy-1-phenyl-ethylsulfamoyl)-biphenyl-3-yl]-ureido}-3H-benzoimidazol-1-ium

ID: ALA1160320

PubChem CID: 21982435

Max Phase: Preclinical

Molecular Formula: C29H25N5O5S

Molecular Weight: 555.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC(NS(=O)(=O)c1cccc(-c2cccc(NC(=O)Nc3nc4ccccc4[nH]3)c2)c1)c1ccccc1

Standard InChI:  InChI=1S/C29H25N5O5S/c35-27(36)18-26(19-8-2-1-3-9-19)34-40(38,39)23-13-7-11-21(17-23)20-10-6-12-22(16-20)30-29(37)33-28-31-24-14-4-5-15-25(24)32-28/h1-17,26,34H,18H2,(H,35,36)(H3,30,31,32,33,37)

Standard InChI Key:  JNSBZXVASWNXFL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    8.6417   -1.8167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5000   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -2.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2167   -1.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -1.7625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3542   -2.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9250   -1.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9792   -3.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0667   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3542   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -2.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0667   -4.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6417   -2.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3542   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -1.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2125   -1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5000   -1.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7875   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -2.6542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0667   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3542   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3542   -4.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6375   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7792   -4.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9167   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4917   -0.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7875   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2000   -0.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8250   -3.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0667   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3542   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6417   -4.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9250   -3.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0417   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5833   -3.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2125   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9292   -4.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2125   -4.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  2  2  0
  4  7  1  0
  5  2  1  0
  6  1  1  0
  7 16  1  0
  8  1  1  0
  9  3  1  0
 10 11  1  0
 11  6  1  0
 12  5  1  0
 13 10  1  0
 14  1  2  0
 15  1  2  0
 16 22  1  0
 17  8  1  0
 18 17  2  0
 19 18  1  0
 20  7  2  0
 21 19  2  0
 22 21  1  0
 23 13  2  0
 24 11  1  0
 25 13  1  0
 26  8  2  0
 27 29  2  0
 28 19  1  0
 29 26  1  0
 30  9  2  0
 31 28  2  0
 32 12  2  0
 33 31  1  0
 34 24  1  0
 35 24  2  0
 36 30  1  0
 37 32  1  0
 38 35  1  0
 39 34  2  0
 40 38  2  0
 18 27  1  0
 40 39  1  0
 33 22  2  0
  9 12  1  0
 36 37  2  0
M  END

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.62Molecular Weight (Monoisotopic): 555.1576AlogP: 5.37#Rotatable Bonds: 9
Polar Surface Area: 153.28Molecular Species: ACIDHBA: 5HBD: 5
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.84CX Basic pKa: 2.40CX LogP: 4.91CX LogD: 1.75
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -1.26

References

1. Urbahns K, Härter M, Albers M, Schmidt D, Stelte-Ludwig B, Brüggemeier U, Vaupel A, Gerdes C..  (2002)  Biphenyls as potent vitronectin receptor antagonists.,  12  (2): [PMID:11755355] [10.1016/s0960-894x(01)00717-x]

Source