2-{3-[3'-((R)-2-Carboxy-1-phenyl-ethylsulfamoyl)-4'-methoxy-biphenyl-3-yl]-ureido}-3H-benzoimidazol-1-ium

ID: ALA1160326

PubChem CID: 10325997

Max Phase: Preclinical

Molecular Formula: C30H27N5O6S

Molecular Weight: 585.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cccc(NC(=O)Nc3nc4ccccc4[nH]3)c2)cc1S(=O)(=O)N[C@H](CC(=O)O)c1ccccc1

Standard InChI:  InChI=1S/C30H27N5O6S/c1-41-26-15-14-21(17-27(26)42(39,40)35-25(18-28(36)37)19-8-3-2-4-9-19)20-10-7-11-22(16-20)31-30(38)34-29-32-23-12-5-6-13-24(23)33-29/h2-17,25,35H,18H2,1H3,(H,36,37)(H3,31,32,33,34,38)/t25-/m1/s1

Standard InChI Key:  DKCBOEVMYBPSHB-RUZDIDTESA-N

Molfile:  

     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
    8.6750    2.3208    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5292    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250    1.4958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9542    2.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2500    2.7208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    2.3750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3875    1.9083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9625    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417    2.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125    1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1000    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3875    1.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750    1.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5292    2.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3875    2.7333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6750    1.4958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1000   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6750    2.7208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9500    3.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8167    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9625    1.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1000    2.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3875    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5250    3.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3875   -0.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2292    3.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8125   -0.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6625    3.9708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8167    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8542    0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1000    1.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000    1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3875    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9542    1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6750   -0.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3792    3.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0750   -0.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5500    0.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417    0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9625   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  2  2  0
  4  1  1  0
  5  8  1  0
  6  2  1  0
  7  1  1  0
  8 18  1  0
  9  4  1  0
 10  3  1  0
 11 12  1  0
 12  7  1  0
 13  6  1  0
 14  9  2  0
 15  1  2  0
 16  1  2  0
 17 11  1  0
 18 23  1  0
 19  4  2  0
 20 14  1  0
 21  8  2  0
 22 20  2  0
 23 22  1  0
 24 27  2  0
 25 17  2  0
 12 26  1  6
 27 19  1  0
 28 17  1  0
 29 19  1  0
 30 20  1  0
 31 10  2  0
 32 30  2  0
 33 13  2  0
 34 32  1  0
 35 26  2  0
 36 26  1  0
 37 29  1  0
 38 31  1  0
 39 33  1  0
 40 35  1  0
 41 36  2  0
 42 41  1  0
 24 14  1  0
 40 42  2  0
 23 34  2  0
 13 10  1  0
 39 38  2  0
M  END

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 585.64Molecular Weight (Monoisotopic): 585.1682AlogP: 5.38#Rotatable Bonds: 10
Polar Surface Area: 162.51Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.74CX Basic pKa: 2.40CX LogP: 4.73CX LogD: 1.54
Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -1.19

References

1. Urbahns K, Härter M, Albers M, Schmidt D, Stelte-Ludwig B, Brüggemeier U, Vaupel A, Gerdes C..  (2002)  Biphenyls as potent vitronectin receptor antagonists.,  12  (2): [PMID:11755355] [10.1016/s0960-894x(01)00717-x]

Source