The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(2-{5-tert-Butyl-3-[(4-methyl-furazan-3-ylmethyl)-amino]-2-oxo-2H-pyrazin-1-yl}-butyrylamino)-5-(hexyl-methyl-amino)-4-oxo-pentanoic acid anion ID: ALA1160520
PubChem CID: 23645305
Max Phase: Preclinical
Molecular Formula: C28H45N7O6
Molecular Weight: 575.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCN(C)CC(=O)[C@H](CC(=O)O)NC(=O)C(CC)n1cc(C(C)(C)C)nc(NCc2nonc2C)c1=O
Standard InChI: InChI=1S/C28H45N7O6/c1-8-10-11-12-13-34(7)16-22(36)19(14-24(37)38)30-26(39)21(9-2)35-17-23(28(4,5)6)31-25(27(35)40)29-15-20-18(3)32-41-33-20/h17,19,21H,8-16H2,1-7H3,(H,29,31)(H,30,39)(H,37,38)/t19-,21?/m0/s1
Standard InChI Key: XIMITGPWYYFUQF-ZQRQZVKFSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
-0.1833 0.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8958 0.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6083 -0.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6083 0.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1750 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8958 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 0.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5375 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0500 1.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5000 0.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6458 1.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 0.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8333 1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3208 0.7208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8958 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0333 0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8958 1.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 -0.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 1.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6667 -1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4375 -1.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8250 0.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2125 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5375 1.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7208 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9000 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0708 -1.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5375 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8167 1.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6792 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9667 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 1.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1042 0.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 2 1 0
5 1 1 0
6 5 2 0
7 9 1 0
8 21 1 0
9 1 1 0
10 11 1 0
11 8 2 0
12 14 2 0
13 7 1 0
14 8 1 0
15 13 1 0
16 15 1 0
15 17 1 6
18 4 1 0
19 17 1 0
20 6 1 0
21 18 1 0
22 2 2 0
23 16 1 0
24 7 2 0
25 16 2 0
26 19 1 0
27 19 2 0
28 23 1 0
29 14 1 0
30 9 1 0
31 20 1 0
32 20 1 0
33 20 1 0
34 28 1 0
35 28 1 0
36 34 1 0
37 38 1 0
38 39 1 0
39 36 1 0
40 30 1 0
41 37 1 0
3 4 2 0
10 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.71Molecular Weight (Monoisotopic): 575.3431AlogP: 2.84#Rotatable Bonds: 17Polar Surface Area: 172.55Molecular Species: ACIDHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.14CX Basic pKa: 7.53CX LogP: -0.55CX LogD: -0.74Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -0.86
References 1. Becker JW, Rotonda J, Soisson SM, Aspiotis R, Bayly C, Francoeur S, Gallant M, Garcia-Calvo M, Giroux A, Grimm E, Han Y, McKay D, Nicholson DW, Peterson E, Renaud J, Roy S, Thornberry N, Zamboni R.. (2004) Reducing the peptidyl features of caspase-3 inhibitors: a structural analysis., 47 (10): [PMID:15115390 ] [10.1021/jm0305523 ]