2-{(S)-1-[(S)-4-Guanidino-1-((S)-1-methoxycarbonyl-3-methyl-butylcarbamoyl)-butylcarbamoyl]-3-phenyl-propylamino}-octanoic acid anion

ID: ALA1160566

PubChem CID: 10008805

Max Phase: Preclinical

Molecular Formula: C31H52N6O6

Molecular Weight: 604.79

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCC(N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)OC)C(=O)O

Standard InChI:  InChI=1S/C31H52N6O6/c1-5-6-7-11-15-25(29(40)41)35-24(18-17-22-13-9-8-10-14-22)28(39)36-23(16-12-19-34-31(32)33)27(38)37-26(20-21(2)3)30(42)43-4/h8-10,13-14,21,23-26,35H,5-7,11-12,15-20H2,1-4H3,(H,36,39)(H,37,38)(H,40,41)(H4,32,33,34)/t23-,24-,25?,26-/m0/s1

Standard InChI Key:  HYOIXDQZRRYZMK-MCSJAMFESA-N

Molfile:  

     RDKit          2D

 43 43  0  0  0  0  0  0  0  0999 V2000
    3.1792   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250   -6.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0375   -5.9292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8917   -6.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7500   -5.9292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0375   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7500   -6.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0375   -7.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4625   -6.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6125   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0375   -6.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250   -2.2167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7500   -7.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792   -5.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250   -7.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3250   -7.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -5.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7500   -7.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4625   -7.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0375   -3.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7500   -2.2167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1792   -6.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792   -7.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792   -8.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -7.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6125   -5.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3250   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9000   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8875   -8.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4625   -8.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3250   -4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3250   -5.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -8.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1792   -7.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3875   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3875   -4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8917   -9.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4625   -9.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1750  -10.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 11  1  0
  3  2  1  0
  4  1  1  0
  5 10  1  0
  6 21  2  0
  7  3  1  0
  8 12  1  0
  9  7  1  0
 10  1  1  0
 11  4  1  0
 12  5  1  0
 13  6  1  0
 14  8  1  0
 15  1  2  0
 16  2  2  0
 17  8  2  0
 18  9  2  0
  7 19  1  6
 10 20  1  6
 21 29  1  0
 22  6  1  0
 23  9  1  0
 24 20  1  0
 25 24  1  0
 26 19  1  0
 11 27  1  1
 28 12  1  0
 29 33  1  0
 30 23  1  0
 31 25  1  0
 32 25  2  0
 33 27  1  0
 34 28  1  0
 35 38  1  0
 36 26  1  0
 37 26  1  0
 38 39  1  0
 39 34  1  0
 40 35  1  0
 41 31  2  0
 42 32  1  0
 43 42  2  0
 41 43  1  0
M  END

Associated Targets(Human)

MMP3 Tchem Matrix metalloproteinase 3 (3433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 604.79Molecular Weight (Monoisotopic): 604.3948AlogP: 2.24#Rotatable Bonds: 22
Polar Surface Area: 198.23Molecular Species: ZWITTERIONHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.91CX Basic pKa: 10.80CX LogP: 2.00CX LogD: 1.59
Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.05Np Likeness Score: 0.48

References

1. Esser CK, Kevin NJ, Yates NA, Chapman KT.  (1997)  Solid-phase synthesis of a N-carboxyalkyl tripeptide combinatorial library,  (20): [10.1016/S0960-894X(97)10049-X]

Source