The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{(S)-1-[(S)-4-Guanidino-1-((S)-1-methoxycarbonyl-3-phenyl-propylcarbamoyl)-butylcarbamoyl]-3-phenyl-propylamino}-octanoic acid anion ID: ALA1160569
PubChem CID: 44322562
Max Phase: Preclinical
Molecular Formula: C35H52N6O6
Molecular Weight: 652.84
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCc1ccccc1)C(=O)OC)C(=O)O
Standard InChI: InChI=1S/C35H52N6O6/c1-3-4-5-12-18-29(33(44)45)39-28(22-20-25-14-8-6-9-15-25)32(43)40-27(19-13-24-38-35(36)37)31(42)41-30(34(46)47-2)23-21-26-16-10-7-11-17-26/h6-11,14-17,27-30,39H,3-5,12-13,18-24H2,1-2H3,(H,40,43)(H,41,42)(H,44,45)(H4,36,37,38)/t27-,28-,29?,30-/m0/s1
Standard InChI Key: JTDLQABYTLWHGW-QCVPMONFSA-N
Molfile:
RDKit 2D
47 48 0 0 0 0 0 0 0 0999 V2000
3.2625 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -4.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9750 -5.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -4.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -1.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -6.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -6.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -6.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -2.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -1.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -5.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9792 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -7.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -7.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -7.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2542 -7.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0250 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0250 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9750 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -8.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -8.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -8.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5417 -8.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 1 0
3 2 1 0
4 1 1 0
5 9 1 0
6 21 2 0
7 12 1 0
8 10 1 0
9 1 1 0
10 3 1 0
11 4 1 0
12 5 1 0
13 6 1 0
14 7 1 0
15 1 2 0
16 2 2 0
17 7 2 0
18 8 2 0
9 19 1 6
10 20 1 6
21 30 1 0
22 6 1 0
23 8 1 0
24 19 1 0
25 20 1 0
26 24 1 0
27 25 1 0
11 28 1 1
29 12 1 0
30 36 1 0
31 23 1 0
32 26 2 0
33 26 1 0
34 27 2 0
35 27 1 0
36 28 1 0
37 29 1 0
38 39 1 0
39 40 1 0
40 37 1 0
41 38 1 0
42 33 2 0
43 34 1 0
44 35 2 0
45 32 1 0
46 42 1 0
47 44 1 0
46 45 2 0
47 43 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 652.84Molecular Weight (Monoisotopic): 652.3948AlogP: 2.83#Rotatable Bonds: 23Polar Surface Area: 198.23Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.91CX Basic pKa: 10.80CX LogP: 2.84CX LogD: 2.44Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.05Np Likeness Score: 0.40
References 1. Esser CK, Kevin NJ, Yates NA, Chapman KT. (1997) Solid-phase synthesis of a N-carboxyalkyl tripeptide combinatorial library, 7 (20): [10.1016/S0960-894X(97)10049-X ]