2-{(S)-1-[(S)-4-Guanidino-1-((S)-1-methoxycarbonyl-pentylcarbamoyl)-butylcarbamoyl]-3-phenyl-propylamino}-octanoic acid anion

ID: ALA1160570

PubChem CID: 44322564

Max Phase: Preclinical

Molecular Formula: C31H52N6O6

Molecular Weight: 604.79

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCC(N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCC)C(=O)OC)C(=O)O

Standard InChI:  InChI=1S/C31H52N6O6/c1-4-6-8-12-17-25(29(40)41)35-24(20-19-22-14-10-9-11-15-22)28(39)36-23(18-13-21-34-31(32)33)27(38)37-26(16-7-5-2)30(42)43-3/h9-11,14-15,23-26,35H,4-8,12-13,16-21H2,1-3H3,(H,36,39)(H,37,38)(H,40,41)(H4,32,33,34)/t23-,24-,25?,26-/m0/s1

Standard InChI Key:  NFDGDKSWNHBFPY-MCSJAMFESA-N

Molfile:  

     RDKit          2D

 43 43  0  0  0  0  0  0  0  0999 V2000
    3.2625   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -5.2167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -4.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -4.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -1.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -6.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -3.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -6.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -6.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -3.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -2.3292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -1.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -5.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -6.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -7.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9792   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -7.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -7.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -6.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -7.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -7.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -8.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -8.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -8.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 10  1  0
  3  1  1  0
  4  2  1  0
  5  9  1  0
  6 20  2  0
  7 12  1  0
  8 11  1  0
  9  1  1  0
 10  3  1  0
 11  4  1  0
 12  5  1  0
 13  6  1  0
 14  7  1  0
 15  1  2  0
 16  2  2  0
 17  7  2  0
 18  8  2  0
  9 19  1  6
 20 28  1  0
 21  6  1  0
 22  8  1  0
 23 19  1  0
 24 23  1  0
 10 25  1  1
 26 12  1  0
 11 27  1  6
 28 32  1  0
 29 22  1  0
 30 24  2  0
 31 24  1  0
 32 25  1  0
 33 27  1  0
 34 26  1  0
 35 37  1  0
 36 33  1  0
 37 38  1  0
 38 34  1  0
 39 35  1  0
 40 36  1  0
 41 30  1  0
 42 31  2  0
 43 42  1  0
 43 41  2  0
M  END

Associated Targets(Human)

MMP3 Tchem Matrix metalloproteinase 3 (3433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 604.79Molecular Weight (Monoisotopic): 604.3948AlogP: 2.39#Rotatable Bonds: 23
Polar Surface Area: 198.23Molecular Species: ZWITTERIONHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.91CX Basic pKa: 10.80CX LogP: 2.15CX LogD: 1.75
Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.05Np Likeness Score: 0.45

References

1. Esser CK, Kevin NJ, Yates NA, Chapman KT.  (1997)  Solid-phase synthesis of a N-carboxyalkyl tripeptide combinatorial library,  (20): [10.1016/S0960-894X(97)10049-X]

Source