The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{(S)-1-[(S)-4-Guanidino-1-((S)-1-methoxycarbonyl-pentylcarbamoyl)-butylcarbamoyl]-3-phenyl-propylamino}-octanoic acid anion ID: ALA1160570
PubChem CID: 44322564
Max Phase: Preclinical
Molecular Formula: C31H52N6O6
Molecular Weight: 604.79
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCC)C(=O)OC)C(=O)O
Standard InChI: InChI=1S/C31H52N6O6/c1-4-6-8-12-17-25(29(40)41)35-24(20-19-22-14-10-9-11-15-22)28(39)36-23(18-13-21-34-31(32)33)27(38)37-26(16-7-5-2)30(42)43-3/h9-11,14-15,23-26,35H,4-8,12-13,16-21H2,1-3H3,(H,36,39)(H,37,38)(H,40,41)(H4,32,33,34)/t23-,24-,25?,26-/m0/s1
Standard InChI Key: NFDGDKSWNHBFPY-MCSJAMFESA-N
Molfile:
RDKit 2D
43 43 0 0 0 0 0 0 0 0999 V2000
3.2625 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9750 -5.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -4.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -4.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -1.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -6.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -6.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -6.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -2.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -1.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -5.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9792 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -7.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -7.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0250 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5500 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0250 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -7.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -8.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9750 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -8.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 10 1 0
3 1 1 0
4 2 1 0
5 9 1 0
6 20 2 0
7 12 1 0
8 11 1 0
9 1 1 0
10 3 1 0
11 4 1 0
12 5 1 0
13 6 1 0
14 7 1 0
15 1 2 0
16 2 2 0
17 7 2 0
18 8 2 0
9 19 1 6
20 28 1 0
21 6 1 0
22 8 1 0
23 19 1 0
24 23 1 0
10 25 1 1
26 12 1 0
11 27 1 6
28 32 1 0
29 22 1 0
30 24 2 0
31 24 1 0
32 25 1 0
33 27 1 0
34 26 1 0
35 37 1 0
36 33 1 0
37 38 1 0
38 34 1 0
39 35 1 0
40 36 1 0
41 30 1 0
42 31 2 0
43 42 1 0
43 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.79Molecular Weight (Monoisotopic): 604.3948AlogP: 2.39#Rotatable Bonds: 23Polar Surface Area: 198.23Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.91CX Basic pKa: 10.80CX LogP: 2.15CX LogD: 1.75Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.05Np Likeness Score: 0.45
References 1. Esser CK, Kevin NJ, Yates NA, Chapman KT. (1997) Solid-phase synthesis of a N-carboxyalkyl tripeptide combinatorial library, 7 (20): [10.1016/S0960-894X(97)10049-X ]