2-{(S)-1-[(S)-1-((S)-3-Carbamoyl-1-methoxycarbonyl-propylcarbamoyl)-4-guanidino-butylcarbamoyl]-3-phenyl-propylamino}-octanoic acid anion

ID: ALA1160575

PubChem CID: 44322757

Max Phase: Preclinical

Molecular Formula: C30H49N7O7

Molecular Weight: 619.76

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCC(N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)OC)C(=O)O

Standard InChI:  InChI=1S/C30H49N7O7/c1-3-4-5-9-13-23(28(41)42)35-22(16-15-20-11-7-6-8-12-20)27(40)36-21(14-10-19-34-30(32)33)26(39)37-24(29(43)44-2)17-18-25(31)38/h6-8,11-12,21-24,35H,3-5,9-10,13-19H2,1-2H3,(H2,31,38)(H,36,40)(H,37,39)(H,41,42)(H4,32,33,34)/t21-,22-,23?,24-/m0/s1

Standard InChI Key:  IJSCISRMHJAJIZ-CNFXVBRLSA-N

Molfile:  

     RDKit          2D

 44 44  0  0  1  0  0  0  0  0999 V2000
    3.2625   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -4.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -5.2167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -4.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -7.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -1.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -6.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -6.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -3.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -6.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -3.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -7.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -2.3292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -1.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -6.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -7.6917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -5.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -6.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -7.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9792   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -7.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -7.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -8.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -8.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -8.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 11  1  0
  3  2  1  0
  4  1  1  0
  5  9  1  0
  6 23  2  0
  7 12  1  0
  8 10  1  0
  9  1  1  0
 10  3  1  0
 11  4  1  0
 12  5  1  0
 13 25  1  0
 14  6  1  0
 15  7  1  0
 16  2  2  0
 17  1  2  0
 18  7  2  0
 19  8  2  0
 20 13  2  0
 10 21  1  6
  9 22  1  6
 23 32  1  0
 24  6  1  0
 25 21  1  0
 26 13  1  0
 27  8  1  0
 28 22  1  0
 29 28  1  0
 11 30  1  1
 31 12  1  0
 32 36  1  0
 33 27  1  0
 34 29  2  0
 35 29  1  0
 36 30  1  0
 37 31  1  0
 38 39  1  0
 39 40  1  0
 40 37  1  0
 41 38  1  0
 42 35  2  0
 43 34  1  0
 44 42  1  0
 44 43  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA1160575

   2-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-methoxy-1,5-dioxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]octanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 619.76

Molecular Weight (Monoisotopic): 619.3693

AlogP: 0.46

#Rotatable Bonds: 23

Polar Surface Area: 241.32

Molecular Species: ZWITTERION

HBA: 8

HBD: 7

#RO5 Violations: 2

HBA (Lipinski): 14

HBD (Lipinski): 10

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 1.91

CX Basic pKa: 10.80

CX LogP: -0.42

CX LogD: -0.82

Aromatic Rings: 1

Heavy Atoms: 44

QED Weighted: 0.04

Np Likeness Score: 0.43

References

1. Esser CK, Kevin NJ, Yates NA, Chapman KT.  (1997)  Solid-phase synthesis of a N-carboxyalkyl tripeptide combinatorial library,  7  (20): [10.1016/S0960-894X(97)10049-X]

Source

Source(1):

• Scientific Literature