The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phosphoric acid mono-{4-[1-(4-tert-butyl-benzyl)-2-oxo-azepan-3-ylcarbamoyl]-phenyl} ester ID: ALA1160752
PubChem CID: 44330291
Max Phase: Preclinical
Molecular Formula: C24H31N2O6P
Molecular Weight: 474.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(CN2CCCC[C@H](NC(=O)c3ccc(OP(=O)(O)O)cc3)C2=O)cc1
Standard InChI: InChI=1S/C24H31N2O6P/c1-24(2,3)19-11-7-17(8-12-19)16-26-15-5-4-6-21(23(26)28)25-22(27)18-9-13-20(14-10-18)32-33(29,30)31/h7-14,21H,4-6,15-16H2,1-3H3,(H,25,27)(H2,29,30,31)/t21-/m0/s1
Standard InChI Key: DYWKARYBKVIDMT-NRFANRHFSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.2417 -6.0542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5792 -8.4542 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.0167 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -5.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 -6.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7167 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8417 -6.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -7.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -8.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -7.9042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3292 -9.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -7.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5208 -5.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7250 -5.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -5.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -6.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -7.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5125 -6.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1333 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8625 -6.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -7.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -5.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6542 -5.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3750 -7.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2542 -6.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8125 -5.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7333 -4.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1083 -6.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -5.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4125 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -4.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 1 0
3 1 1 0
4 5 1 0
6 5 1 6
6 3 1 0
7 1 1 0
8 4 1 0
9 2 1 0
10 2 1 0
11 22 1 0
12 2 2 0
13 3 2 0
14 15 1 0
15 20 2 0
16 4 2 0
17 8 1 0
18 8 2 0
19 24 2 0
20 25 1 0
21 7 1 0
22 26 2 0
23 1 1 0
24 21 1 0
25 21 2 0
26 18 1 0
27 17 2 0
28 6 1 0
29 14 1 0
30 14 1 0
31 14 1 0
32 23 1 0
33 32 1 0
33 28 1 0
19 15 1 0
27 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.49Molecular Weight (Monoisotopic): 474.1920AlogP: 3.77#Rotatable Bonds: 6Polar Surface Area: 116.17Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.78CX Basic pKa: ┄CX LogP: 3.54CX LogD: 0.43Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -0.60
References 1. Lange G, Lesuisse D, Deprez P, Schoot B, Loenze P, Bénard D, Marquette JP, Broto P, Sarubbi E, Mandine E.. (2002) Principles governing the binding of a class of non-peptidic inhibitors to the SH2 domain of src studied by X-ray analysis., 45 (14): [PMID:12086479 ] [10.1021/jm0110800 ]