({4-[2-Acetylamino-2-(1-biphenyl-4-ylmethyl-2-oxo-azepan-3-ylcarbamoyl)-ethyl]-phenyl}-difluoro-methyl)-phosphonic acid

ID: ALA1160756

PubChem CID: 447523

Max Phase: Preclinical

Molecular Formula: C31H34F2N3O6P

Molecular Weight: 613.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)N[C@H]1CCCCN(Cc2ccc(-c3ccccc3)cc2)C1=O

Standard InChI:  InChI=1S/C31H34F2N3O6P/c1-21(37)34-28(19-22-12-16-26(17-13-22)31(32,33)43(40,41)42)29(38)35-27-9-5-6-18-36(30(27)39)20-23-10-14-25(15-11-23)24-7-3-2-4-8-24/h2-4,7-8,10-17,27-28H,5-6,9,18-20H2,1H3,(H,34,37)(H,35,38)(H2,40,41,42)/t27-,28-/m0/s1

Standard InChI Key:  LVZDQVATAQEMCX-NSOVKSMOSA-N

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    2.6448    1.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8198    1.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073    2.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8198    3.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6448    3.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0573    2.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073    3.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6929    3.4022    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1218    4.2272    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9948    4.5291    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.5823    5.2436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2804    4.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7093    4.9416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0573    0.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6448    0.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8198    0.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073   -0.4721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073    0.9568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0573   -0.4721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8823   -0.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2948    0.2423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2948   -1.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5823   -0.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2244   -1.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5799   -1.3990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7388   -1.8605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2249   -0.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2249   -0.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7635   -2.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5519   -2.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5799    0.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2244    0.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7354   -3.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5238   -3.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1286   -2.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9450   -2.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1566   -1.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9169   -3.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1005   -3.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8888   -4.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4936   -3.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3100   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5217   -2.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  2  0
  1 14  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  7  4  1  0
  5  6  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 11 10  2  0
 12 10  1  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 15 19  1  6
 16 17  1  0
 16 18  2  0
 23 17  1  6
 20 19  1  0
 20 21  2  0
 20 22  1  0
 23 24  1  0
 23 32  1  0
 24 25  1  0
 24 26  2  0
 27 25  1  0
 29 25  1  0
 27 28  1  0
 28 31  1  0
 29 30  1  0
 30 33  1  0
 30 37  2  0
 31 32  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 35 38  1  0
 36 37  1  0
 38 39  1  0
 38 43  2  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1160756

   N-Acetyl-N-[1-(1,1'-biphenyl-4-ylmethyl)-2-oxoazepan-3-YL]-4-[difluoro(phosphono)methyl]phenylalaninamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 613.60

Molecular Weight (Monoisotopic): 613.2153

AlogP: 4.33

#Rotatable Bonds: 10

Polar Surface Area: 136.04

Molecular Species: ACID

HBA: 4

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 0.49

CX Basic pKa: ┄

CX LogP: 3.28

CX LogD: 0.53

Aromatic Rings: 3

Heavy Atoms: 43

QED Weighted: 0.25

Np Likeness Score: -0.49

References

1. Lange G, Lesuisse D, Deprez P, Schoot B, Loenze P, Bénard D, Marquette JP, Broto P, Sarubbi E, Mandine E..  (2002)  Principles governing the binding of a class of non-peptidic inhibitors to the SH2 domain of src studied by X-ray analysis.,  45  (14): [PMID:12086479] [10.1021/jm0110800]

2. Lange G, Lesuisse D, Deprez P, Schoot B, Loenze P, Bénard D, Marquette JP, Broto P, Sarubbi E, Mandine E..  (2003)  Requirements for specific binding of low affinity inhibitor fragments to the SH2 domain of (pp60)Src are identical to those for high affinity binding of full length inhibitors.,  46  (24): [PMID:14613321] [10.1021/jm020970s]

Source

Source(1):

• Scientific Literature