[(4-{2-Acetylamino-2-[1-(3-cyclohexyl-propyl)-2-oxo-azepan-3-ylcarbamoyl]-ethyl}-phenyl)-difluoro-methyl]-phosphonic acid

ID: ALA1160760

PubChem CID: 44330511

Max Phase: Preclinical

Molecular Formula: C27H40F2N3O6P

Molecular Weight: 571.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)N[C@H]1CCCCN(CCCC2CCCCC2)C1=O

Standard InChI:  InChI=1S/C27H40F2N3O6P/c1-19(33)30-24(18-21-12-14-22(15-13-21)27(28,29)39(36,37)38)25(34)31-23-11-5-6-16-32(26(23)35)17-7-10-20-8-3-2-4-9-20/h12-15,20,23-24H,2-11,16-18H2,1H3,(H,30,33)(H,31,34)(H2,36,37,38)/t23-,24-/m0/s1

Standard InChI Key:  FFADFKAUBUZNPR-ZEQRLZLVSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
    8.1375   -2.8125    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.1542   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4792   -7.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6042   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8750   -7.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7000   -7.1250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3000   -7.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667   -8.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1250   -4.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1667   -2.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7167   -2.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9667   -8.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9542   -2.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5667   -8.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6292   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0292   -7.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3542   -3.6167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9792   -3.6167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9375   -9.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3917   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8250   -5.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0625   -6.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3667   -5.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7917   -5.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1167   -7.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4292   -6.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6917   -8.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9542   -7.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7417   -8.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7417   -7.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3792   -8.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8667   -5.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -5.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4125   -8.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0458   -6.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6250   -7.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  8  1  0
  5  4  1  0
  6  3  1  0
  7  5  1  6
  8 17  1  0
  8  9  1  6
 10  2  1  0
 11  1  1  0
 12  1  1  0
 13  9  1  0
 14  1  2  0
 15  3  2  0
 16  4  2  0
 17 23  1  0
 18  2  1  0
 19  2  1  0
 20 13  2  0
 21 10  1  0
 22 10  2  0
 23 25  2  0
 24 21  2  0
 25 22  1  0
 26  6  1  0
 27  6  1  0
 28 26  1  0
 29  7  1  0
 30 13  1  0
 31 32  1  0
 32 28  1  0
 33 31  1  0
 34 31  1  0
 35 36  1  0
 36 29  1  0
 37 34  1  0
 38 33  1  0
 39 37  1  0
 24 23  1  0
 35 27  1  0
 38 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1160760

   [[4-[(2S)-2-acetamido-3-[[(3S)-1-(3-cyclohexylpropyl)-2-oxoazepan-3-yl]amino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 571.60

Molecular Weight (Monoisotopic): 571.2623

AlogP: 3.82

#Rotatable Bonds: 11

Polar Surface Area: 136.04

Molecular Species: ACID

HBA: 4

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 0.49

CX Basic pKa: ┄

CX LogP: 2.68

CX LogD: -0.08

Aromatic Rings: 1

Heavy Atoms: 39

QED Weighted: 0.30

Np Likeness Score: -0.30

References

1. Lange G, Lesuisse D, Deprez P, Schoot B, Loenze P, Bénard D, Marquette JP, Broto P, Sarubbi E, Mandine E..  (2002)  Principles governing the binding of a class of non-peptidic inhibitors to the SH2 domain of src studied by X-ray analysis.,  45  (14): [PMID:12086479] [10.1021/jm0110800]

Source

Source(1):

• Scientific Literature