The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cyclic urea 2,4-diazepin-3-one analogue ID: ALA1160793
PubChem CID: 46905377
Max Phase: Preclinical
Molecular Formula: C27H32F6N6O5
Molecular Weight: 406.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)c1cccc(N2CCCCN(C3CCN(Cc4ccncc4)CC3)C2=O)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C23H30N6O.2C2HF3O2/c24-22(25)19-4-3-5-21(16-19)29-13-2-1-12-28(23(29)30)20-8-14-27(15-9-20)17-18-6-10-26-11-7-18;2*3-2(4,5)1(6)7/h3-7,10-11,16,20H,1-2,8-9,12-15,17H2,(H3,24,25);2*(H,6,7)
Standard InChI Key: OOGTWEAFXVHPNM-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 45 0 0 0 0 0 0 0 0999 V2000
-1.7500 -0.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7500 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 -0.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2583 -0.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3250 0.3333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.1833 0.3333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7500 0.4625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 -2.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1417 -2.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4583 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0083 -2.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0083 -1.7917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -3.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 -2.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4708 -3.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4417 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1542 -2.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 -5.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -3.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8917 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5333 -2.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0333 -1.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3167 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4583 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -5.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 -5.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -4.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 -5.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0083 -1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6083 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -1.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2250 -2.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2250 -2.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -1.3042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -1.4375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -1.4375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 2 0
5 1 1 0
6 1 1 0
7 1 1 0
9 8 1 0
10 8 1 0
11 9 1 0
12 17 1 0
13 12 2 0
14 10 1 0
15 22 1 0
16 11 2 0
17 16 1 0
18 8 2 0
19 14 1 0
20 14 1 0
21 33 1 0
22 19 1 0
23 20 1 0
24 15 1 0
25 12 1 0
26 9 1 0
27 10 1 0
28 24 1 0
29 11 1 0
30 17 2 0
31 29 2 0
32 34 1 0
33 35 2 0
34 28 2 0
35 28 1 0
36 27 1 0
37 26 1 0
37 36 1 0
15 23 1 0
30 31 1 0
32 21 2 0
39 38 1 0
40 39 1 0
41 39 2 0
42 38 1 0
43 38 1 0
44 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.53Molecular Weight (Monoisotopic): 406.2481AlogP: 3.05#Rotatable Bonds: 5Polar Surface Area: 89.55Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 11.17CX LogP: 1.05CX LogD: -1.83Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.25
References 1. Galemmo RA, Wells BL, Rossi KA, Alexander RS, Dominguez C, Maduskuie TP, Stouten PF, Wright MR, Aungst BJ, Wong PC, Knabb RM, Wexler RR.. (2000) The de novo design and synthesis of cyclic urea inhibitors of factor Xa: optimization of the S4 ligand., 10 (3): [PMID:10698459 ] [10.1016/s0960-894x(99)00688-5 ]