The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-Aza-bicyclo[2.2.2]oct-3-yl)-2-(N',N''-dicyclohexyl-guanidino)-3-naphthalen-2-yl-propionamide ID: ALA1160968
PubChem CID: 44346306
Max Phase: Preclinical
Molecular Formula: C33H47N5O
Molecular Weight: 529.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CN2CCC1CC2)C(Cc1ccc2ccccc2c1)N/C(=N/C1CCCCC1)NC1CCCCC1
Standard InChI: InChI=1S/C33H47N5O/c39-32(36-31-23-38-19-17-26(31)18-20-38)30(22-24-15-16-25-9-7-8-10-27(25)21-24)37-33(34-28-11-3-1-4-12-28)35-29-13-5-2-6-14-29/h7-10,15-16,21,26,28-31H,1-6,11-14,17-20,22-23H2,(H,36,39)(H2,34,35,37)
Standard InChI Key: DQUWHEDLZKSAKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
4.1167 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 -0.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3417 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0125 -2.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9167 -1.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5875 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8375 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -3.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 -2.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -3.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5000 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4250 -1.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9125 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7250 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -5.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9542 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0625 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3667 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4750 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 -5.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1042 -0.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5000 -4.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9500 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1250 -5.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4000 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0000 -2.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3000 -2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3542 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9417 -5.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6292 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 6 1 0
4 3 1 0
5 1 1 0
6 5 1 0
7 4 1 0
8 10 1 0
9 1 1 0
10 7 1 0
11 7 1 0
12 6 1 0
13 3 2 0
14 16 1 0
15 12 1 0
16 15 2 0
17 22 1 0
18 11 1 0
19 11 1 0
20 18 1 0
21 19 1 0
22 24 2 0
23 2 1 0
24 15 1 0
25 9 1 0
26 14 1 0
27 17 1 0
28 23 1 0
29 23 1 0
30 25 1 0
31 25 1 0
32 26 2 0
33 27 2 0
34 30 1 0
35 29 1 0
36 28 1 0
37 31 1 0
38 37 1 0
39 35 1 0
34 38 1 0
39 36 1 0
14 17 2 0
8 21 1 0
20 8 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.77Molecular Weight (Monoisotopic): 529.3781AlogP: 5.16#Rotatable Bonds: 7Polar Surface Area: 68.76Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 11.74CX LogP: 5.63CX LogD: 2.63Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -0.18
References 1. Salvino JM, Seoane PR, Douty BD, Awad MA, Hoyer D, Ross TM, Dolle RE, Houck WT, Faunce DM, Sawutz DG. (1995) Structure activity relationships of non-peptide bradykinin B2 receptor antagonists, 5 (4): [10.1016/0960-894X(95)00035-R ] 2. Salvino JM, Seoane PR, Douty BD, Awad MA, Hoyer D, Ross TM, Dolle RE, Houck WT, Faunce DM, Sawutz DG. (1995) Structure activity relationships of non-peptide bradykinin B2 receptor antagonists, 5 (4): [10.1016/0960-894X(95)00035-R ]