N-(1H-Benzoimidazol-2-yl)-2-(N',N''-dicyclohexyl-guanidino)-3-naphthalen-2-yl-propionamide

ID: ALA1160971

PubChem CID: 44346361

Max Phase: Preclinical

Molecular Formula: C33H40N6O

Molecular Weight: 536.72

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1nc2ccccc2[nH]1)[C@H](Cc1ccc2ccccc2c1)N/C(=N/C1CCCCC1)NC1CCCCC1

Standard InChI:  InChI=1S/C33H40N6O/c40-31(39-33-36-28-17-9-10-18-29(28)37-33)30(22-23-19-20-24-11-7-8-12-25(24)21-23)38-32(34-26-13-3-1-4-14-26)35-27-15-5-2-6-16-27/h7-12,17-21,26-27,30H,1-6,13-16,22H2,(H2,34,35,38)(H2,36,37,39,40)/t30-/m0/s1

Standard InChI Key:  MJINWJWKMZJGER-PMERELPUSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    8.9250   -5.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -4.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4042   -4.6667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1000   -5.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4125   -5.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9917   -3.6917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4292   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -4.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6750   -5.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1875   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1875   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -5.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -6.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5125   -4.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2167   -7.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0000   -6.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8125   -6.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8042   -8.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875   -8.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1917   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -7.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7917   -5.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8917   -4.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8917   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0375   -7.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2125   -8.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7875   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4875   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0875   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3875   -5.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6042   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6125   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4417   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0292   -8.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8625   -3.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4625   -5.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -5.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -5.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  8  1  0
  3  1  2  0
  4  1  1  0
  5  1  1  0
  6  2  2  0
  7  4  1  0
  8  9  1  0
  9  7  1  0
 10  3  1  0
 11  5  1  0
 12  2  1  0
  9 13  1  6
 14  7  2  0
 15 17  1  0
 16 13  1  0
 17 16  2  0
 18 19  1  0
 19 21  2  0
 20  6  1  0
 21 16  1  0
 22 12  1  0
 23 10  1  0
 24 11  1  0
 25 15  1  0
 26 18  1  0
 27 20  1  0
 28 20  1  0
 29 22  1  0
 30 22  1  0
 31 23  2  0
 32 24  2  0
 33 25  2  0
 34 26  2  0
 35 27  1  0
 36 30  1  0
 37 29  1  0
 38 28  1  0
 39 36  1  0
 40 38  1  0
 10 11  2  0
 32 31  1  0
 15 18  2  0
 33 34  1  0
 37 39  1  0
 35 40  1  0
M  END

Associated Targets(Human)

BDKRB2 Tclin Bradykinin B2 receptor (3970 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.72Molecular Weight (Monoisotopic): 536.3264AlogP: 6.47#Rotatable Bonds: 7
Polar Surface Area: 94.20Molecular Species: BASEHBA: 3HBD: 4
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.39CX Basic pKa: 12.03CX LogP: 6.55CX LogD: 5.65
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -0.53

References

1. Salvino JM, Seoane PR, Douty BD, Awad MA, Hoyer D, Ross TM, Dolle RE, Houck WT, Faunce DM, Sawutz DG.  (1995)  Structure activity relationships of non-peptide bradykinin B2 receptor antagonists,  (4): [10.1016/0960-894X(95)00035-R]

Source