3-[3-(2-Benzenesulfonylamino-ethyl)-5-pyridin-3-ylmethyl-phenyl]-propionic acid

ID: ALA116196

PubChem CID: 10764803

Max Phase: Preclinical

Molecular Formula: C23H24N2O4S

Molecular Weight: 424.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CCc1cc(CCNS(=O)(=O)c2ccccc2)cc(Cc2cccnc2)c1

Standard InChI:  InChI=1S/C23H24N2O4S/c26-23(27)9-8-18-13-19(15-21(14-18)16-20-5-4-11-24-17-20)10-12-25-30(28,29)22-6-2-1-3-7-22/h1-7,11,13-15,17,25H,8-10,12,16H2,(H,26,27)

Standard InChI Key:  ITVKVHZSOCJLEY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    3.1375   -0.3042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1375   -1.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1292    0.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4167    0.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125   -0.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8500    0.1125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7167   -3.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2167    0.1125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5167   -3.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7042   -1.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9917   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4167   -1.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6917    0.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1250    0.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9917   -1.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5042   -2.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7125   -2.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1417   -3.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8417   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625   -0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4167    0.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750    0.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4375   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7042   -0.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4167    0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0625   -1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8542   -1.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917    0.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7042    1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917    0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  2  0
  4  1  1  0
  5 13  2  0
  6  1  1  0
  7 16  1  0
  8 21  1  0
  9  7  2  0
 10 15  1  0
 11 22  1  0
 12 10  2  0
 13 11  1  0
 14  5  1  0
 15 11  2  0
 16 17  1  0
 17 10  1  0
 18  7  1  0
 19 14  1  0
 20  6  1  0
 21 19  2  0
 22 20  1  0
 23 27  1  0
 24  4  2  0
 25  4  1  0
 26 19  1  0
 27 26  2  0
 28 24  1  0
 29 25  2  0
 30 29  1  0
 28 30  2  0
 12  5  1  0
 23  8  2  0
M  END

Associated Targets(Human)

TBXAS1 Tchem Thromboxane-A synthase (3355 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Tbxa2r Thromboxane A2 receptor (199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.52Molecular Weight (Monoisotopic): 424.1457AlogP: 3.21#Rotatable Bonds: 10
Polar Surface Area: 96.36Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.06CX Basic pKa: 5.43CX LogP: 2.66CX LogD: 0.91
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -0.72

References

1. Dickinson RP, Dack KN, Long CJ, Steele J..  (1997)  Thromboxane modulating agents. 3. 1H-imidazol-1-ylalkyl- and 3-pyridinylalkyl-substituted 3-[2-[(arylsulfonyl)amino]ethyl]benzenepropanoic acid derivatives as dual thromboxane synthase inhibitor/thromboxane receptor antagonists.,  40  (21): [PMID:9341919] [10.1021/jm9702793]

Source