2-cyclopentyl-2-hydroxy-2-phenyl-N-[3-(3-phenylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]acetamide

ID: ALA1162964

PubChem CID: 46905988

Max Phase: Preclinical

Molecular Formula: C27H34N2O2

Molecular Weight: 418.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1[C@@H]2CN(CCCc3ccccc3)C[C@@H]21)C(O)(c1ccccc1)C1CCCC1

Standard InChI:  InChI=1S/C27H34N2O2/c30-26(27(31,22-15-7-8-16-22)21-13-5-2-6-14-21)28-25-23-18-29(19-24(23)25)17-9-12-20-10-3-1-4-11-20/h1-6,10-11,13-14,22-25,31H,7-9,12,15-19H2,(H,28,30)/t23-,24+,25+,27?

Standard InChI Key:  DJBRSVQJAQGQJK-CPYPIWFDSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
  -12.4928  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9053  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7304  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.1429  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7304  -16.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9053  -16.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6678  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8428  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6678  -16.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6678  -14.9679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.3353  -17.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0803  -17.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2553  -17.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0004  -17.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4303  -15.0784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4303  -16.5073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6053  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8909  -15.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8909  -14.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1063  -15.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6213  -15.0784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1062  -14.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7963  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3839  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5589  -15.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1464  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3213  -15.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9088  -14.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3214  -13.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1464  -13.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5589  -14.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8909  -13.8409    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8909  -16.3159    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  9 11  1  0
  9 14  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  1  0
  8 16  2  0
 17 15  1  6
 17 18  1  0
 19 17  1  0
 18 20  1  0
 19 18  1  0
 19 22  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 31  2  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 19 32  1  6
 18 33  1  6
M  END

Associated Targets(non-human)

Chrm3 Muscarinic acetylcholine receptor M3 (655 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Chrm2 Muscarinic acetylcholine receptor M2 (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Chrm3 Muscarinic receptor M2 and M3 (126 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.58Molecular Weight (Monoisotopic): 418.2620AlogP: 3.74#Rotatable Bonds: 8
Polar Surface Area: 52.57Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.98CX Basic pKa: 9.18CX LogP: 4.15CX LogD: 2.37
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -0.29

References

1. Kumar N, Kaur K, Aeron S, Dharmarajan S, Silamkoti AD, Mehta A, Gupta S, Chugh A, Gupta JB, Salman M, Palle VP, Cliffe IA..  (2007)  Synthesis and optimization of novel and selective muscarinic M(3) receptor antagonists.,  17  (18): [PMID:17629699] [10.1016/j.bmcl.2007.06.081]

Source