The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Benzyloxy-2-benzyl-9-isobutyl-1-methyl-beta-carboliniumbromide ID: ALA1164886
PubChem CID: 46703939
Max Phase: Preclinical
Molecular Formula: C30H31BrN2O
Molecular Weight: 435.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(cc[n+]1Cc1ccccc1)c1ccc(OCc3ccccc3)cc1n2CC(C)C.[Br-]
Standard InChI: InChI=1S/C30H31N2O.BrH/c1-22(2)19-32-29-18-26(33-21-25-12-8-5-9-13-25)14-15-27(29)28-16-17-31(23(3)30(28)32)20-24-10-6-4-7-11-24;/h4-18,22H,19-21H2,1-3H3;1H/q+1;/p-1
Standard InChI Key: OSYCZZCZMSDAPI-UHFFFAOYSA-M
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
14.8605 -22.1345 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
12.7418 -22.3949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1186 -21.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3935 -21.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2031 -22.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7384 -21.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4591 -20.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6498 -20.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0600 -21.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2925 -21.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7261 -20.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9268 -20.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6973 -21.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2654 -22.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6080 -22.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9773 -21.9373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7662 -23.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2668 -21.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0633 -23.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5626 -21.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9780 -22.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5637 -22.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9785 -23.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8055 -23.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2159 -22.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7988 -22.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3360 -23.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0877 -24.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2765 -20.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9991 -20.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0091 -19.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2981 -19.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5755 -19.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5690 -20.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13 16 1 0
6 7 1 0
2 17 1 0
3 10 1 0
16 18 1 0
7 8 2 0
17 19 1 0
8 3 1 0
6 20 1 0
20 21 1 0
21 22 2 0
9 10 2 0
22 23 1 0
3 4 2 0
23 24 2 0
10 11 1 0
24 25 1 0
9 2 1 0
25 26 2 0
26 21 1 0
11 12 2 0
19 27 1 0
4 5 1 0
19 28 1 0
12 13 1 0
18 29 1 0
29 30 2 0
13 14 2 0
30 31 1 0
14 9 1 0
31 32 2 0
5 6 2 0
32 33 1 0
5 15 1 0
33 34 2 0
34 29 1 0
2 4 1 0
M CHG 2 1 -1 6 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.59Molecular Weight (Monoisotopic): 435.2431AlogP: 6.67#Rotatable Bonds: 7Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -0.22
References 1. Cao R, Guan X, Shi B, Chen Z, Ren Z, Peng W, Song H.. (2010) Design, synthesis and 3D-QSAR of beta-carboline derivatives as potent antitumor agents., 45 (6): [PMID:20304536 ] [10.1016/j.ejmech.2010.02.036 ] 2. Cao R, Fan W, Guo L, Ma Q, Zhang G, Li J, Chen X, Ren Z, Qiu L.. (2013) Synthesis and structure-activity relationships of harmine derivatives as potential antitumor agents., 60 [PMID:23291116 ] [10.1016/j.ejmech.2012.11.045 ]