Methyl4-[(5-[(2,4-diamino-6-quinazolinyl)methyl]amino-2-methoxyphenoxy)methyl]benzene carboxylate

ID: ALA1165306

PubChem CID: 46907163

Max Phase: Preclinical

Molecular Formula: C25H25N5O4

Molecular Weight: 459.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(COc2cc(NCc3ccc4nc(N)nc(N)c4c3)ccc2OC)cc1

Standard InChI:  InChI=1S/C25H25N5O4/c1-32-21-10-8-18(12-22(21)34-14-15-3-6-17(7-4-15)24(31)33-2)28-13-16-5-9-20-19(11-16)23(26)30-25(27)29-20/h3-12,28H,13-14H2,1-2H3,(H4,26,27,29,30)

Standard InChI Key:  BYCSTMIHRAHFHA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   12.3497   -5.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0662   -5.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0633   -4.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3479   -4.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6349   -5.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6372   -4.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9245   -4.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2091   -4.5419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2108   -5.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9240   -5.7799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7762   -4.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4922   -4.5326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2052   -4.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9196   -4.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6320   -4.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6293   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9083   -2.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1988   -3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3478   -4.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3417   -2.8741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9259   -3.3055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4973   -5.7848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0609   -4.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7768   -4.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7859   -5.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4973   -5.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2099   -5.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2077   -4.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4868   -4.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0583   -3.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9256   -5.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9279   -6.5758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6389   -5.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3545   -5.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 16 17  1  0
  3  4  2  0
 17 18  2  0
 18 13  1  0
  8  9  2  0
 15 19  1  0
  4  6  1  0
 16 20  1  0
  9 10  1  0
  7 21  1  0
 10  5  2  0
  9 22  1  0
  1  2  2  0
 19 23  1  0
  3 11  1  0
 23 24  1  0
  5  1  1  0
 11 12  1  0
 25 26  2  0
  5  6  1  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  2  3  1  0
 28 29  1  0
 29 24  2  0
 24 25  1  0
 13 14  2  0
 20 30  1  0
  6  7  2  0
 27 31  1  0
 14 15  1  0
 31 32  2  0
 31 33  1  0
 15 16  2  0
 33 34  1  0
M  END

Associated Targets(Human)

DHFR Tclin Dihydrofolate reductase (3072 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Bifunctional dihydrofolate reductase-thymidylate synthase (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.51Molecular Weight (Monoisotopic): 459.1907AlogP: 3.78#Rotatable Bonds: 8
Polar Surface Area: 134.61Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.99CX LogP: 3.65CX LogD: 3.51
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -0.83

References

1. Schormann N, Velu SE, Murugesan S, Senkovich O, Walker K, Chenna BC, Shinkre B, Desai A, Chattopadhyay D..  (2010)  Synthesis and characterization of potent inhibitors of Trypanosoma cruzi dihydrofolate reductase.,  18  (11): [PMID:20452776] [10.1016/j.bmc.2010.04.020]

Source