1-(8-Methoxy-4-o-tolylamino-quinolin-3-yl)-butan-1-ol (0.5H2O)

ID: ALA116786

PubChem CID: 10427130

Max Phase: Preclinical

Molecular Formula: C21H24N2O2

Molecular Weight: 336.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(O)c1cnc2c(OC)cccc2c1Nc1ccccc1C

Standard InChI:  InChI=1S/C21H24N2O2/c1-4-8-18(24)16-13-22-21-15(10-7-12-19(21)25-3)20(16)23-17-11-6-5-9-14(17)2/h5-7,9-13,18,24H,4,8H2,1-3H3,(H,22,23)

Standard InChI Key:  QAGWRXTZANBLKN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    3.2792   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -6.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2875   -5.1167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2792   -7.5917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -7.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5750   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8542   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7125   -5.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5792   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8542   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8625   -8.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7167   -5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1500   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8625   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1500   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -6.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -8.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1417   -5.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1500   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8542   -6.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1500   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  1  1  0
  5  6  2  0
  6  3  1  0
  7  2  2  0
  8  4  1  0
  9  6  1  0
 10  2  1  0
 11  8  2  0
 12  3  1  0
 13  9  1  0
 14 10  1  0
 15 12  2  0
 16  8  1  0
 17 15  1  0
 18 11  1  0
 19 11  1  0
 20 10  1  0
 21 13  1  0
 22 20  1  0
 23 16  2  0
 24 22  1  0
 25 23  1  0
  5  7  1  0
 17  9  2  0
 25 19  2  0
M  END

Associated Targets(non-human)

ATP4B Potassium-transporting ATPase (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.44Molecular Weight (Monoisotopic): 336.1838AlogP: 5.13#Rotatable Bonds: 6
Polar Surface Area: 54.38Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.20CX LogP: 4.54CX LogD: 4.54
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.66Np Likeness Score: -0.62

References

1. Ife RJ, Brown TH, Keeling DJ, Leach CA, Meeson ML, Parsons ME, Reavill DR, Theobald CJ, Wiggall KJ..  (1992)  Reversible inhibitors of the gastric (H+/K+)-ATPase. 3. 3-substituted-4-(phenylamino)quinolines.,  35  (18): [PMID:1326634] [10.1021/jm00096a018]

Source