The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-{4-[3-(2-Amino-4-oxo-3,4,5,6,7,8-hexahydro-pyrido[2,3-d]pyrimidin-6-yl)-propyl]-benzoylamino}-pentanedioic acid ID: ALA117353
PubChem CID: 136076369
Max Phase: Preclinical
Molecular Formula: C22H27N5O6
Molecular Weight: 457.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2c(n1)NCC(CCCc1ccc(C(=O)N[C@H](CCC(=O)O)C(=O)O)cc1)C2
Standard InChI: InChI=1S/C22H27N5O6/c23-22-26-18-15(20(31)27-22)10-13(11-24-18)3-1-2-12-4-6-14(7-5-12)19(30)25-16(21(32)33)8-9-17(28)29/h4-7,13,16H,1-3,8-11H2,(H,25,30)(H,28,29)(H,32,33)(H4,23,24,26,27,31)/t13?,16-/m1/s1
Standard InChI Key: GFHUCCQIBDDMRG-FQNRMIAFSA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
-2.4250 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1333 -1.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4208 -0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8375 -0.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1333 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8375 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7125 -1.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 -1.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7083 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1333 0.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2500 0.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8375 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5583 -1.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5375 1.3750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9958 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2625 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2625 -2.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 1.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9958 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8750 -1.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 0.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2750 0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3750 -1.1000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 5 1 0
5 3 2 0
6 2 1 0
7 1 1 0
8 13 1 0
9 8 1 0
11 10 1 6
11 9 1 1
12 3 1 0
13 21 1 0
14 5 1 0
15 24 1 0
16 8 2 0
17 10 2 0
18 6 1 0
19 15 2 0
11 20 1 6
21 29 2 0
22 28 1 0
23 7 1 0
24 20 1 0
25 10 1 0
26 15 1 0
27 23 1 0
28 30 2 0
29 30 1 0
30 32 1 0
31 33 1 0
32 31 1 0
33 27 1 0
11 34 1 1
6 4 2 0
12 27 1 0
22 13 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.49Molecular Weight (Monoisotopic): 457.1961AlogP: 1.42#Rotatable Bonds: 10Polar Surface Area: 187.76Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.34CX Basic pKa: 3.83CX LogP: 1.84CX LogD: -4.18Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: 0.29
References 1. Shih C, Grindey G, Taylor E, Harrington P. (1992) Synthesis and biological activity of nor- and homo-5,10-dideazatetrahydrofolic acid, 2 (4): [10.1016/S0960-894X(01)80214-6 ]