The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-Amino-2-{5-[(2-amino-4-oxo-3,4-dihydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-amino]-1-oxo-1,3-dihydro-isoindol-2-yl}-pentanoic acid ID: ALA117462
PubChem CID: 135528799
Max Phase: Preclinical
Molecular Formula: C21H23N7O4
Molecular Weight: 437.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCC[C@@H](C(=O)O)N1Cc2cc(NCc3cnc4nc(N)nc(O)c4c3)ccc2C1=O
Standard InChI: InChI=1S/C21H23N7O4/c22-5-1-2-16(20(31)32)28-10-12-7-13(3-4-14(12)19(28)30)24-8-11-6-15-17(25-9-11)26-21(23)27-18(15)29/h3-4,6-7,9,16,24H,1-2,5,8,10,22H2,(H,31,32)(H3,23,25,26,27,29)/t16-/m0/s1
Standard InChI Key: IRSZGKLLTGEBKA-INIZCTEOSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
5.3917 -2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 -4.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8542 -2.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2875 -3.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7417 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7417 -3.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2875 -4.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3500 -2.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3750 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9042 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9625 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2625 -4.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0917 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2625 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8375 -1.6125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 -2.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -1.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8167 -3.4292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 -4.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3375 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3000 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3292 -2.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6667 -1.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 -4.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4042 -2.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7125 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2667 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -2.1250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 2 0
3 1 1 0
4 6 1 0
5 13 1 0
6 7 2 0
7 15 1 0
8 2 1 0
9 3 1 0
10 11 1 0
11 1 1 0
12 1 1 0
13 24 2 0
14 12 1 0
15 20 2 0
16 9 2 0
17 3 2 0
18 6 1 0
19 10 2 0
20 26 1 0
21 14 2 0
22 25 1 0
23 8 1 0
24 20 1 0
25 19 1 0
26 22 1 0
27 16 1 0
28 14 1 0
29 31 1 0
30 12 1 0
31 32 1 0
32 30 1 0
12 33 1 1
9 10 1 0
27 25 2 0
7 5 1 0
4 8 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.46Molecular Weight (Monoisotopic): 437.1812AlogP: 1.07#Rotatable Bonds: 8Polar Surface Area: 180.58Molecular Species: ZWITTERIONHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.45CX Basic pKa: 9.72CX LogP: -1.87CX LogD: -1.87Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -0.41
References 1. Rosowsky A, Forsch RA, Null A, Moran RG.. (1999) 5-deazafolate analogues with a rotationally restricted glutamate or ornithine side chain: synthesis and binding interaction with folylpolyglutamate synthetase., 42 (18): [PMID:10479284 ] [10.1021/jm9807205 ]