The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2N-(3-amino-3-imminopropyl)-4-[4-(3-chloropropylcarboxamido)-1-methyl-1H-2-pyrrolylcarboxamido]-1-methyl-1H-2-pyrrolecarboxamide chloride ID: ALA117594
PubChem CID: 49796524
Max Phase: Preclinical
Molecular Formula: C19H27Cl2N7O3
Molecular Weight: 435.92
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cn1cc(NC(=O)c2cc(NC(=O)CCCCl)cn2C)cc1C(=O)NCCC(=N)N
Standard InChI: InChI=1S/C19H26ClN7O3.ClH/c1-26-11-13(9-14(26)18(29)23-7-5-16(21)22)25-19(30)15-8-12(10-27(15)2)24-17(28)4-3-6-20;/h8-11H,3-7H2,1-2H3,(H3,21,22)(H,23,29)(H,24,28)(H,25,30);1H
Standard InChI Key: XAWZKXXPCNXZJC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
11.9000 -5.9292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6292 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -7.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9542 -6.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -7.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -6.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3667 -5.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -5.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5542 -7.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0167 -6.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6792 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -6.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4667 -6.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0542 -4.9542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -7.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6792 -6.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8417 -8.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2458 -4.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -6.8500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6417 -7.6125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -7.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -8.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9542 -7.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0708 -6.7292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.0958 -5.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2458 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9125 -5.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 9 2 0
4 2 1 0
5 11 1 0
6 2 1 0
7 13 1 0
8 2 2 0
9 7 1 0
10 8 1 0
11 7 2 0
12 4 1 0
13 6 1 0
14 3 1 0
15 16 2 0
16 20 1 0
17 10 1 0
18 17 1 0
19 6 2 0
20 25 1 0
21 14 2 0
22 18 2 0
23 14 1 0
24 16 1 0
25 23 1 0
26 5 1 0
27 4 1 0
28 30 1 0
29 18 1 0
30 31 1 0
31 29 1 0
12 10 2 0
3 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.92Molecular Weight (Monoisotopic): 435.1786AlogP: 1.63#Rotatable Bonds: 10Polar Surface Area: 147.03Molecular Species: BASEHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: 12.53CX LogP: -0.35CX LogD: -2.55Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.22Np Likeness Score: -0.84
References 1. Krowicki K, Balzarini J, De Clercq E, Newman RA, Lown JW.. (1988) Novel DNA groove binding alkylators: design, synthesis, and biological evaluation., 31 (2): [PMID:2828620 ] [10.1021/jm00397a012 ]