The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{3-[2-(4-Bromo-benzenesulfonylamino)-ethyl]-5-pyridin-3-ylmethyl-phenyl}-propionic acid ID: ALA118008
PubChem CID: 10744075
Max Phase: Preclinical
Molecular Formula: C23H23BrN2O4S
Molecular Weight: 503.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCc1cc(CCNS(=O)(=O)c2ccc(Br)cc2)cc(Cc2cccnc2)c1
Standard InChI: InChI=1S/C23H23BrN2O4S/c24-21-4-6-22(7-5-21)31(29,30)26-11-9-18-12-17(3-8-23(27)28)13-20(14-18)15-19-2-1-10-25-16-19/h1-2,4-7,10,12-14,16,26H,3,8-9,11,15H2,(H,27,28)
Standard InChI Key: YSNQLPNLRJCVLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
3.9667 -4.7292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -5.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9625 -5.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -3.9042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6875 -4.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2042 -8.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0917 -4.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9167 -8.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5125 -6.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8167 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2500 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -4.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -5.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5417 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9667 -4.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8000 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2042 -7.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -5.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4917 -6.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4875 -8.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5375 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8250 -5.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -6.3542 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.6750 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -4.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 -4.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1125 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0792 -5.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6542 -5.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3625 -6.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 2 0
5 15 1 0
6 1 1 0
7 18 1 0
8 27 1 0
9 7 2 0
10 17 2 0
11 28 1 0
12 2 1 0
13 2 2 0
14 10 1 0
15 11 2 0
16 5 1 0
17 11 1 0
18 20 1 0
19 23 2 0
20 10 1 0
21 7 1 0
22 12 2 0
23 13 1 0
24 19 1 0
25 16 1 0
26 6 1 0
27 25 2 0
28 26 1 0
29 31 1 0
30 25 1 0
31 30 2 0
19 22 1 0
5 14 2 0
29 8 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.42Molecular Weight (Monoisotopic): 502.0562AlogP: 3.97#Rotatable Bonds: 10Polar Surface Area: 96.36Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.06CX Basic pKa: 5.43CX LogP: 3.43CX LogD: 1.68Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -0.78
References 1. Dickinson RP, Dack KN, Long CJ, Steele J.. (1997) Thromboxane modulating agents. 3. 1H-imidazol-1-ylalkyl- and 3-pyridinylalkyl-substituted 3-[2-[(arylsulfonyl)amino]ethyl]benzenepropanoic acid derivatives as dual thromboxane synthase inhibitor/thromboxane receptor antagonists., 40 (21): [PMID:9341919 ] [10.1021/jm9702793 ]