The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[3-(2-Benzenesulfonylamino-ethyl)-5-(pyridin-3-yloxy)-phenyl]-propionic acid ID: ALA118084
PubChem CID: 11796683
Max Phase: Preclinical
Molecular Formula: C22H22N2O5S
Molecular Weight: 426.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCc1cc(CCNS(=O)(=O)c2ccccc2)cc(Oc2cccnc2)c1
Standard InChI: InChI=1S/C22H22N2O5S/c25-22(26)9-8-17-13-18(15-20(14-17)29-19-5-4-11-23-16-19)10-12-24-30(27,28)21-6-2-1-3-7-21/h1-7,11,13-16,24H,8-10,12H2,(H,25,26)
Standard InChI Key: YGFCJXBEWFGZOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.1375 -0.3042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 -1.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1292 0.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4125 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 0.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 0.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7167 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1250 0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2167 0.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -3.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -0.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6917 0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -2.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7125 -2.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -3.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8417 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4167 0.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 0.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4375 -0.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0625 -1.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8542 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 0.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 2 0
4 14 2 0
5 1 1 0
6 1 1 0
7 16 1 0
8 4 1 0
9 21 1 0
10 7 2 0
11 15 1 0
12 22 1 0
13 11 2 0
14 12 1 0
15 12 2 0
16 17 1 0
17 11 1 0
18 7 1 0
19 8 1 0
20 6 1 0
21 19 2 0
22 20 1 0
23 27 1 0
24 5 2 0
25 5 1 0
26 19 1 0
27 26 2 0
28 24 1 0
29 25 2 0
30 29 1 0
30 28 2 0
4 13 1 0
23 9 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.49Molecular Weight (Monoisotopic): 426.1249AlogP: 3.41#Rotatable Bonds: 10Polar Surface Area: 105.59Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.56CX Basic pKa: 4.65CX LogP: 2.24CX LogD: -0.08Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.98
References 1. Dickinson RP, Dack KN, Long CJ, Steele J.. (1997) Thromboxane modulating agents. 3. 1H-imidazol-1-ylalkyl- and 3-pyridinylalkyl-substituted 3-[2-[(arylsulfonyl)amino]ethyl]benzenepropanoic acid derivatives as dual thromboxane synthase inhibitor/thromboxane receptor antagonists., 40 (21): [PMID:9341919 ] [10.1021/jm9702793 ]