The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-(5-chloro-2-methoxybenzamido)ethyl]-2,4-dimethoxy-benzenesulfonyl-3-methlthiourea ID: ALA11827
PubChem CID: 10767760
Max Phase: Preclinical
Molecular Formula: C20H24ClN3O6S2
Molecular Weight: 502.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN/C(S)=N/S(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)c(OC)cc1OC
Standard InChI: InChI=1S/C20H24ClN3O6S2/c1-22-20(31)24-32(26,27)18-9-12(16(29-3)11-17(18)30-4)7-8-23-19(25)14-10-13(21)5-6-15(14)28-2/h5-6,9-11H,7-8H2,1-4H3,(H,23,25)(H2,22,24,31)
Standard InChI Key: YUXCZTNZTZVAPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
0.0875 -2.6167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.4333 -2.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 -2.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0500 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4375 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9458 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5333 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9625 -1.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 -2.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4333 -2.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4750 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4708 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5708 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0500 -3.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -3.2167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5333 -1.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0208 -2.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6375 -2.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0958 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5708 -3.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 -1.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9958 -1.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0958 -3.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5833 -4.1542 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.5708 -1.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5000 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9833 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6292 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0750 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5125 -1.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0958 -1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 8 1 0
5 3 2 0
6 2 2 0
7 2 1 0
8 18 1 0
9 6 1 0
10 1 2 0
11 1 2 0
12 13 1 0
13 7 2 0
14 4 2 0
15 4 1 0
16 5 1 0
17 8 2 0
18 27 1 0
19 5 1 0
20 14 1 0
21 15 2 0
22 6 1 0
23 12 1 0
24 21 1 0
25 21 1 0
26 14 1 0
27 28 1 0
28 13 1 0
29 19 1 0
30 22 1 0
31 23 1 0
32 26 1 0
12 9 2 0
24 20 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.01Molecular Weight (Monoisotopic): 501.0795AlogP: 2.53#Rotatable Bonds: 9Polar Surface Area: 115.32Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.35CX Basic pKa: 1.36CX LogP: 2.67CX LogD: 1.84Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -1.15
References 1. Englert HC, Gerlach U, Goegelein H, Hartung J, Heitsch H, Mania D, Scheidler S.. (2001) Cardioselective K(ATP) channel blockers derived from a new series of m-anisamidoethylbenzenesulfonylthioureas., 44 (7): [PMID:11297455 ] [10.1021/jm000985v ]