The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-Benzyloxycarbonylamino-6-oxo-2-phenyl-6H-pyrimidin-1-yl)-2-hydroxymethyl-but-2-enoic acid methyl ester ID: ALA119187
PubChem CID: 11026726
Max Phase: Preclinical
Molecular Formula: C24H23N3O6
Molecular Weight: 449.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C(=C/Cn1c(-c2ccccc2)ncc(NC(=O)OCc2ccccc2)c1=O)CO
Standard InChI: InChI=1S/C24H23N3O6/c1-32-23(30)19(15-28)12-13-27-21(18-10-6-3-7-11-18)25-14-20(22(27)29)26-24(31)33-16-17-8-4-2-5-9-17/h2-12,14,28H,13,15-16H2,1H3,(H,26,31)/b19-12+
Standard InChI Key: LIRKKNJPAWDJLB-XDHOZWIPSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
6.5417 -6.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1167 -6.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5375 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8167 -5.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1042 -5.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6792 -6.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -6.8375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2542 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6875 -6.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9667 -6.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -6.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -7.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -5.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6792 -5.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -5.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9750 -6.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1125 -6.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6875 -7.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -6.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -6.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -8.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9625 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2417 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8250 -6.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5500 -7.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8292 -6.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6750 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9500 -3.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -6.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8417 -8.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -7.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 -4.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 1 1 0
5 4 2 0
6 5 1 0
7 11 2 0
8 2 1 0
9 1 1 0
10 8 1 0
11 9 1 0
12 7 1 0
13 3 2 0
14 4 1 0
15 10 2 0
16 12 2 0
17 10 1 0
18 12 1 0
19 7 1 0
20 17 1 0
21 20 1 0
22 19 1 0
23 14 2 0
24 14 1 0
25 18 1 0
26 21 1 0
27 21 2 0
28 23 1 0
29 24 2 0
30 27 1 0
31 26 2 0
32 30 2 0
33 29 1 0
6 2 2 0
28 33 2 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.46Molecular Weight (Monoisotopic): 449.1587AlogP: 2.75#Rotatable Bonds: 8Polar Surface Area: 119.75Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.19CX Basic pKa: 0.53CX LogP: 2.50CX LogD: 2.50Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.16
References 1. Zhu S, Hudson TH, Kyle DE, Lin AJ.. (2002) Synthesis and in vitro studies of novel pyrimidinyl peptidomimetics as potential antimalarial therapeutic agents., 45 (16): [PMID:12139460 ] [10.1021/jm020104f ]