4-(5-Benzyloxycarbonylamino-6-oxo-2-phenyl-6H-pyrimidin-1-yl)-2-hydroxymethyl-but-2-enoic acid methyl ester

ID: ALA119187

PubChem CID: 11026726

Max Phase: Preclinical

Molecular Formula: C24H23N3O6

Molecular Weight: 449.46

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)/C(=C/Cn1c(-c2ccccc2)ncc(NC(=O)OCc2ccccc2)c1=O)CO

Standard InChI:  InChI=1S/C24H23N3O6/c1-32-23(30)19(15-28)12-13-27-21(18-10-6-3-7-11-18)25-14-20(22(27)29)26-24(31)33-16-17-8-4-2-5-9-17/h2-12,14,28H,13,15-16H2,1H3,(H,26,31)/b19-12+

Standard InChI Key:  LIRKKNJPAWDJLB-XDHOZWIPSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    6.5417   -6.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1167   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -6.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -5.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8167   -5.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1042   -5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6792   -6.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042   -6.8375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -6.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875   -6.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9667   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3917   -6.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -7.6542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2500   -5.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6792   -5.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3917   -5.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9750   -6.8417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1125   -6.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6875   -7.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2542   -6.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -6.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4042   -8.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9625   -5.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417   -4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8250   -6.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5500   -7.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -6.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6750   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9500   -3.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -6.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8417   -8.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -7.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -4.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  1  0
  5  4  2  0
  6  5  1  0
  7 11  2  0
  8  2  1  0
  9  1  1  0
 10  8  1  0
 11  9  1  0
 12  7  1  0
 13  3  2  0
 14  4  1  0
 15 10  2  0
 16 12  2  0
 17 10  1  0
 18 12  1  0
 19  7  1  0
 20 17  1  0
 21 20  1  0
 22 19  1  0
 23 14  2  0
 24 14  1  0
 25 18  1  0
 26 21  1  0
 27 21  2  0
 28 23  1  0
 29 24  2  0
 30 27  1  0
 31 26  2  0
 32 30  2  0
 33 29  1  0
  6  2  2  0
 28 33  2  0
 31 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA119187

   methyl (E)-2-(hydroxymethyl)-4-[6-oxo-2-phenyl-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl]but-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 449.46

Molecular Weight (Monoisotopic): 449.1587

AlogP: 2.75

#Rotatable Bonds: 8

Polar Surface Area: 119.75

Molecular Species: NEUTRAL

HBA: 8

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 9

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 11.19

CX Basic pKa: 0.53

CX LogP: 2.50

CX LogD: 2.50

Aromatic Rings: 3

Heavy Atoms: 33

QED Weighted: 0.40

Np Likeness Score: -0.16

References

1. Zhu S, Hudson TH, Kyle DE, Lin AJ..  (2002)  Synthesis and in vitro studies of novel pyrimidinyl peptidomimetics as potential antimalarial therapeutic agents.,  45  (16): [PMID:12139460] [10.1021/jm020104f]

Source

Source(1):

• Scientific Literature