The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2-Amino-4-oxo-3,4,5,6,7,8-hexahydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-amino]-benzoylamino}-pentanedioic acid ID: ALA119674
PubChem CID: 135474705
Max Phase: Preclinical
Molecular Formula: C20H24N6O6
Molecular Weight: 444.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2c(n1)NCC(CNc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)C2
Standard InChI: InChI=1S/C20H24N6O6/c21-20-25-16-13(18(30)26-20)7-10(9-23-16)8-22-12-3-1-11(2-4-12)17(29)24-14(19(31)32)5-6-15(27)28/h1-4,10,14,22H,5-9H2,(H,24,29)(H,27,28)(H,31,32)(H4,21,23,25,26,30)
Standard InChI Key: XQZVRAWIARJOCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
3.7875 -5.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0750 -5.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7875 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 -4.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0750 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 -5.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5000 -5.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5125 -2.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -3.3250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9417 -2.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5000 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9417 -2.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0750 -3.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0917 -3.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5042 -2.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6542 -1.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6375 -5.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6500 -4.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8042 -2.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -5.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6625 -3.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0750 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3625 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3792 -2.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9292 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -1.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0917 -4.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0750 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3625 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 5 1 0
5 3 2 0
6 2 1 0
7 1 1 0
8 13 1 0
9 8 1 0
10 12 1 0
11 3 1 0
12 9 1 0
13 24 2 0
14 5 1 0
15 27 1 0
16 8 2 0
17 10 2 0
18 22 1 0
19 6 1 0
20 28 1 0
21 15 2 0
22 7 1 0
23 12 1 0
24 32 1 0
25 31 2 0
26 20 1 0
27 23 1 0
28 18 1 0
29 10 1 0
30 15 1 0
31 26 1 0
32 26 2 0
4 6 2 0
18 11 1 0
13 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.45Molecular Weight (Monoisotopic): 444.1757AlogP: 0.51#Rotatable Bonds: 9Polar Surface Area: 199.79Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.23CX Basic pKa: 4.38CX LogP: -1.00CX LogD: -6.08Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.04
References 1. Rosowsky A, Forsch RA, Null A, Moran RG.. (1999) 5-deazafolate analogues with a rotationally restricted glutamate or ornithine side chain: synthesis and binding interaction with folylpolyglutamate synthetase., 42 (18): [PMID:10479284 ] [10.1021/jm9807205 ]