(2R)-1,4-oxazinan-2-ylmethyl 3-(1,4-oxazinan-4-ylmethyl)-2H-8-chromenyl ether: Compound with Oxalate

ID: ALA1201939

PubChem CID: 49859808

Max Phase: Preclinical

Molecular Formula: C21H28N2O8

Molecular Weight: 346.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C1=C(CN2CCOCC2)COc2c1cccc2OCC1CNCCO1.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C19H26N2O4.C2H2O4/c1-2-16-10-15(12-21-5-8-22-9-6-21)13-25-19(16)18(3-1)24-14-17-11-20-4-7-23-17;3-1(4)2(5)6/h1-3,10,17,20H,4-9,11-14H2;(H,3,4)(H,5,6)

Standard InChI Key:  WREIEFKWCACDCL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    6.3187    1.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7312    0.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5562    0.3572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3187   -0.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7312   -1.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4937   -0.3572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9145   -1.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6290   -0.6435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6290    0.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3435    0.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3435    1.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6290    1.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9145    1.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2001    1.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5144    1.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2289    1.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9434    1.4190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6578    1.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3723    1.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3723    0.5940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6578    0.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9434    0.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5144    0.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2001    0.1815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9145    0.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9145   -1.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2001   -2.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2001   -3.1185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9145   -3.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6290   -3.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6290   -2.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  4  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 17  1  0
 15 23  1  0
 23 24  1  0
 24 25  1  0
 25  9  1  0
 25 13  2  0
  7 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 26  1  0
M  END

Associated Targets(non-human)

Htr1b Serotonin 1b (5-HT1b) receptor (2343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.43Molecular Weight (Monoisotopic): 346.1893AlogP: 1.16#Rotatable Bonds: 5
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.20CX LogP: 0.95CX LogD: 0.06
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.86Np Likeness Score: -0.42

References

1. Berg S, Larsson LG, Rényi L, Ross SB, Thorberg SO, Thorell-Svantesson G..  (1998)  (R)-(+)-2-[[[3-(Morpholinomethyl)-2H-chromen-8-yl]oxy]methyl] morpholine methanesulfonate: a new selective rat 5-hydroxytryptamine1B receptor antagonist.,  41  (11): [PMID:9599242] [10.1021/jm970806i]

Source