The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-1,4-oxazinan-2-ylmethyl 3-(1,4-oxazinan-4-ylmethyl)-2H-8-chromenyl ether: Compound with Oxalate ID: ALA1201939
PubChem CID: 49859808
Max Phase: Preclinical
Molecular Formula: C21H28N2O8
Molecular Weight: 346.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C1=C(CN2CCOCC2)COc2c1cccc2OCC1CNCCO1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C19H26N2O4.C2H2O4/c1-2-16-10-15(12-21-5-8-22-9-6-21)13-25-19(16)18(3-1)24-14-17-11-20-4-7-23-17;3-1(4)2(5)6/h1-3,10,17,20H,4-9,11-14H2;(H,3,4)(H,5,6)
Standard InChI Key: WREIEFKWCACDCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
6.3187 1.0717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7312 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5562 0.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3187 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7312 -1.0717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4937 -0.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9145 -1.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6290 -0.6435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6290 0.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3435 0.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3435 1.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6290 1.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9145 1.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2001 1.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5144 1.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2289 1.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9434 1.4190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6578 1.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3723 1.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3723 0.5940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6578 0.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9434 0.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5144 0.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2001 0.1815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9145 0.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9145 -1.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2001 -2.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2001 -3.1185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9145 -3.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6290 -3.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6290 -2.2935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 0
4 6 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
15 23 1 0
23 24 1 0
24 25 1 0
25 9 1 0
25 13 2 0
7 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 346.43Molecular Weight (Monoisotopic): 346.1893AlogP: 1.16#Rotatable Bonds: 5Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.20CX LogP: 0.95CX LogD: 0.06Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.86Np Likeness Score: -0.42
References 1. Berg S, Larsson LG, Rényi L, Ross SB, Thorberg SO, Thorell-Svantesson G.. (1998) (R)-(+)-2-[[[3-(Morpholinomethyl)-2H-chromen-8-yl]oxy]methyl] morpholine methanesulfonate: a new selective rat 5-hydroxytryptamine1B receptor antagonist., 41 (11): [PMID:9599242 ] [10.1021/jm970806i ]