2-[4-Carboxy-4-(4-carboxy-4-{4-[(4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyrylamino)-butyrylamino]-pentanedioic acid;0.5trifluoroacetic acid

ID: ALA1202140

PubChem CID: 135998842

Max Phase: Preclinical

Molecular Formula: C36H37F3N6O14

Molecular Weight: 720.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: C#CCN(Cc1ccc2ncnc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)cc1.O=C(O)C(F)(F)F

Standard InChI: InChI=1S/C34H36N6O12.C2HF3O2/c1-2-15-40(17-19-3-8-23-22(16-19)31(46)36-18-35-23)21-6-4-20(5-7-21)30(45)39-26(34(51)52)10-13-28(42)37-24(32(47)48)9-12-27(41)38-25(33(49)50)11-14-29(43)44;3-2(4,5)1(6)7/h1,3-8,16,18,24-26H,9-15,17H2,(H,37,42)(H,38,41)(H,39,45)(H,43,44)(H,47,48)(H,49,50)(H,51,52)(H,35,36,46);(H,6,7)/t24-,25-,26-;/m0./s1

Standard InChI Key: JREIGAFVCNMGJR-OUKLVGRUSA-N

Molfile:

     RDKit          2D

 59 60  0  0  0  0  0  0  0  0999 V2000
    6.3928    4.9522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    3.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3534    3.1525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928    3.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7323    3.6019    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7320    2.4020    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928    1.8022    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -28.6007    4.0234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -28.6026    5.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -29.6430    5.8214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -27.3038    5.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -26.0026    5.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -24.7038    5.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.4027    5.2316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -22.1039    5.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -22.1058    7.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -20.8027    5.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.5039    5.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.2027    5.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9039    5.9920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6027    5.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6008    4.0440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.3039    5.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0028    5.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7040    6.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4028    5.2523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1040    6.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1059    7.2044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8028    5.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5036    6.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2047    5.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2049    3.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5041    3.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8030    3.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067    3.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6040    3.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3068    2.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2695    2.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091    1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    2.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7033    7.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6641    8.1012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7424    8.1012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1972    3.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.1562    3.1422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -19.2345    3.1356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -24.7031    7.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.6640    8.0806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -25.7423    8.0806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  4  6  1  0
  4  7  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 13 12  1  1
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 19 18  1  6
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 25 24  1  1
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  3  0
 35 39  1  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 48  1  0
 47 49  1  0
 49 43  1  0
 49 50  2  0
 50 40  1  0
 25 51  1  0
 51 52  2  0
 51 53  1  0
 19 54  1  0
 54 55  2  0
 54 56  1  0
 13 57  1  0
 57 58  2  0
 57 59  1  0
M  END

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 720.69	Molecular Weight (Monoisotopic): 720.2391	AlogP: 0.72	#Rotatable Bonds: 20
Polar Surface Area: 285.75	Molecular Species: ACID	HBA: 11	HBD: 8
#RO5 Violations: 3	HBA (Lipinski): 18	HBD (Lipinski): 8	#RO5 Violations (Lipinski): 3
CX Acidic pKa: 2.91	CX Basic pKa: 0.84	CX LogP: 0.77	CX LogD: -12.43
Aromatic Rings: 3	Heavy Atoms: 52	QED Weighted: 0.07	Np Likeness Score: -0.57

References

1. Bisset GM, Pawelczak K, Jackman AL, Calvert AH, Hughes LR.. (1992) Syntheses and thymidylate synthase inhibitory activity of the poly-gamma-glutamyl conjugates of N-[5-[N-(3,4-dihydro-2-methyl-4-oxoquinazolin-6-ylmethyl)-N-methylamino ]-2-thenoyl]-L-glutamic acid (ICI D1694) and other quinazoline antifolates., 35 (5): [PMID:1372358] [10.1021/jm00083a008]

2-[4-Carboxy-4-(4-carboxy-4-{4-[(4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyrylamino)-butyrylamino]-pentanedioic acid;0.5trifluoroacetic acid

Names and Identifiers

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source