The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1'-(2-benzo[c][1,2,5]oxadiazol-5-ylethyl)-4-hydroxyspiro[3,4-dihydro-2H-chromene-2,4'-(hexahydropyridine)]-6-yl]methanesulfonamide hydrochloride ID: ALA1203301
PubChem CID: 11753909
Max Phase: Preclinical
Molecular Formula: C22H27ClN4O5S
Molecular Weight: 458.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)Nc1ccc2c(c1)C(O)CC1(CCN(CCc3ccc4nonc4c3)CC1)O2.Cl
Standard InChI: InChI=1S/C22H26N4O5S.ClH/c1-32(28,29)25-16-3-5-21-17(13-16)20(27)14-22(30-21)7-10-26(11-8-22)9-6-15-2-4-18-19(12-15)24-31-23-18;/h2-5,12-13,20,25,27H,6-11,14H2,1H3;1H
Standard InChI Key: DTIIARNOWDUZRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
15.7044 -0.8935 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.3753 -4.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4171 -3.7780 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.4535 -4.3829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4117 -4.9780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4232 -2.2772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1270 -1.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1270 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8194 0.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5259 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7675 0.7249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0752 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4448 1.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8946 1.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9890 0.7391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4454 1.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4867 0.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9436 0.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9770 -0.7026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4550 -0.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8615 1.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2044 1.7522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9929 3.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5414 3.4918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8285 2.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3636 1.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5768 -0.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1412 -1.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0752 -1.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7675 -2.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7647 -3.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5259 -1.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8194 -2.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
3 5 2 0
3 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
25 26 1 0
26 18 2 0
15 27 1 0
27 28 1 0
28 12 1 0
12 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
32 10 1 0
32 33 2 0
33 7 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.54Molecular Weight (Monoisotopic): 458.1624AlogP: 2.49#Rotatable Bonds: 5Polar Surface Area: 117.79Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.37CX Basic pKa: 8.68CX LogP: 0.53CX LogD: -0.62Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -0.96
References 1. Elliott JM, Selnick HG, Claremon DA, Baldwin JJ, Buhrow SA, Butcher JW, Habecker CN, King SW, Lynch JJ, Phillips BT.. (1992) 4-Oxospiro[benzopyran-2,4'-piperidines] as class III antiarrhythmic agents. Pharmacological studies on 3,4-dihydro-1'-[2-(benzofurazan-5-yl)- ethyl]-6-methanesulfonamidospiro[(2H)-1-benzopyran-2,4'-piperidin]-4-on e (L-691,121)., 35 (21): [PMID:1433205 ] [10.1021/jm00099a028 ]