3-hydroxy-N-(4-methoxyphenethyl)-2-naphthamide

ID: ALA1208928

PubChem CID: 27548444

Max Phase: Preclinical

Molecular Formula: C20H19NO3

Molecular Weight: 321.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CCNC(=O)c2cc3ccccc3cc2O)cc1

Standard InChI:  InChI=1S/C20H19NO3/c1-24-17-8-6-14(7-9-17)10-11-21-20(23)18-12-15-4-2-3-5-16(15)13-19(18)22/h2-9,12-13,22H,10-11H2,1H3,(H,21,23)

Standard InChI Key:  VJWXLRADQQTOHE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -5.2260  -15.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2272  -16.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5125  -17.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5143  -15.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7989  -15.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7981  -16.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0829  -17.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3679  -16.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3727  -15.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0886  -15.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6608  -15.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9439  -15.8088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6658  -14.5757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6519  -17.0572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2320  -15.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4850  -15.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1968  -15.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9119  -15.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6233  -15.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6187  -14.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8968  -14.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1883  -14.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3301  -14.1352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0475  -14.5422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 11 12  1  0
  5  6  1  0
 11 13  2  0
  3  6  2  0
  8 14  1  0
  6  7  1  0
 12 15  1  0
  1  2  2  0
 15 16  1  0
  7  8  2  0
 16 17  1  0
  5  4  2  0
 17 18  2  0
  8  9  1  0
 18 19  1  0
  4  1  1  0
 19 20  2  0
  9 10  2  0
 20 21  1  0
 10  5  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
  9 11  1  0
 23 24  1  0
M  END

Associated Targets(Human)

DNM1 Tbio Dynamin-1 (215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.38Molecular Weight (Monoisotopic): 321.1365AlogP: 3.53#Rotatable Bonds: 5
Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.97CX Basic pKa: CX LogP: 4.24CX LogD: 4.14
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.76Np Likeness Score: -0.51

References

1. Lee S, Jung KY, Park J, Cho JH, Kim YC, Chang S..  (2010)  Synthesis of potent chemical inhibitors of dynamin GTPase.,  20  (16): [PMID:20621477] [10.1016/j.bmcl.2010.06.092]

Source