N-methyl-4-(4-(4-((4-methylpiperazin-1-yl)methyl)benzamido)phenoxy)picolinamide

ID: ALA1213922

PubChem CID: 49863686

Max Phase: Preclinical

Molecular Formula: C26H29N5O3

Molecular Weight: 459.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(Oc2ccc(NC(=O)c3ccc(CN4CCN(C)CC4)cc3)cc2)ccn1

Standard InChI:  InChI=1S/C26H29N5O3/c1-27-26(33)24-17-23(11-12-28-24)34-22-9-7-21(8-10-22)29-25(32)20-5-3-19(4-6-20)18-31-15-13-30(2)14-16-31/h3-12,17H,13-16,18H2,1-2H3,(H,27,33)(H,29,32)

Standard InChI Key:  VQIBSZYZJIEVJB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   16.0333   -3.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6042   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3208   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3167   -3.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6000   -2.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0250   -3.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0333   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7458   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3208   -3.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7500   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0375   -4.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6042   -5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4667   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8833   -2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8917   -4.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7417   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4583   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6042   -3.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6000   -3.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3083   -2.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0250   -2.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3125   -3.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1792   -4.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1708   -2.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0333   -3.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7500   -3.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1708   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4500   -2.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6042   -4.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8833   -3.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8917   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1750   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7417   -3.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1750   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  7  1  0
  4  1  1  0
  5 14  1  0
  6 21  1  0
  7 10  2  0
  8  1  1  0
  9  3  2  0
 10 13  1  0
 11  1  2  0
 12  2  2  0
 13 23  1  0
 14 24  1  0
 15  2  1  0
 16  8  1  0
 17  8  2  0
 18  4  1  0
 19  5  1  0
 20  5  1  0
 21 20  1  0
 22 19  1  0
 23 32  1  0
 24 28  1  0
 25 26  2  0
 26 10  1  0
 27 17  1  0
 28 16  2  0
 29 18  2  0
 30 18  1  0
 31 29  1  0
 32 30  2  0
 33  6  1  0
 34 15  1  0
 24 27  2  0
 31 23  2  0
  6 22  1  0
  9 25  1  0
M  END

Associated Targets(Human)

BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abl1 Tyrosine-protein kinase ABL (212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2270AlogP: 3.23#Rotatable Bonds: 7
Polar Surface Area: 86.80Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.99CX Basic pKa: 7.84CX LogP: 2.60CX LogD: 2.02
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.31

References

1. Dietrich J, Hulme C, Hurley LH..  (2010)  The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796.,  18  (15): [PMID:20621496] [10.1016/j.bmc.2010.05.063]

Source