The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-4-(4-(4-((4-methylpiperazin-1-yl)methyl)benzamido)phenoxy)picolinamide ID: ALA1213922
PubChem CID: 49863686
Max Phase: Preclinical
Molecular Formula: C26H29N5O3
Molecular Weight: 459.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1cc(Oc2ccc(NC(=O)c3ccc(CN4CCN(C)CC4)cc3)cc2)ccn1
Standard InChI: InChI=1S/C26H29N5O3/c1-27-26(33)24-17-23(11-12-28-24)34-22-9-7-21(8-10-22)29-25(32)20-5-3-19(4-6-20)18-31-15-13-30(2)14-16-31/h3-12,17H,13-16,18H2,1-2H3,(H,27,33)(H,29,32)
Standard InChI Key: VQIBSZYZJIEVJB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
16.0333 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6042 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3208 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3167 -3.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6000 -2.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0250 -3.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0333 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7458 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3208 -3.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7500 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0375 -4.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6042 -5.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4667 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8833 -2.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8917 -4.5375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7417 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4583 -3.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6042 -3.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6000 -3.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3083 -2.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0250 -2.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3125 -3.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1792 -4.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1708 -2.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0333 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7500 -3.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1708 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4500 -2.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6042 -4.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8833 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8917 -4.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1750 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7417 -3.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1750 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 7 1 0
4 1 1 0
5 14 1 0
6 21 1 0
7 10 2 0
8 1 1 0
9 3 2 0
10 13 1 0
11 1 2 0
12 2 2 0
13 23 1 0
14 24 1 0
15 2 1 0
16 8 1 0
17 8 2 0
18 4 1 0
19 5 1 0
20 5 1 0
21 20 1 0
22 19 1 0
23 32 1 0
24 28 1 0
25 26 2 0
26 10 1 0
27 17 1 0
28 16 2 0
29 18 2 0
30 18 1 0
31 29 1 0
32 30 2 0
33 6 1 0
34 15 1 0
24 27 2 0
31 23 2 0
6 22 1 0
9 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2270AlogP: 3.23#Rotatable Bonds: 7Polar Surface Area: 86.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.99CX Basic pKa: 7.84CX LogP: 2.60CX LogD: 2.02Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.31
References 1. Dietrich J, Hulme C, Hurley LH.. (2010) The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796., 18 (15): [PMID:20621496 ] [10.1016/j.bmc.2010.05.063 ]