The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-methylpiperazin-1-yl)methyl)-N-(4-(2-morpholinoethoxy)naphthalen-1-yl)benzamide ID: ALA1213923
PubChem CID: 49863687
Max Phase: Preclinical
Molecular Formula: C29H36N4O3
Molecular Weight: 488.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(Cc2ccc(C(=O)Nc3ccc(OCCN4CCOCC4)c4ccccc34)cc2)CC1
Standard InChI: InChI=1S/C29H36N4O3/c1-31-12-14-33(15-13-31)22-23-6-8-24(9-7-23)29(34)30-27-10-11-28(26-5-3-2-4-25(26)27)36-21-18-32-16-19-35-20-17-32/h2-11H,12-22H2,1H3,(H,30,34)
Standard InChI Key: XIWBIVHGXQNDRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.4250 -10.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7083 -10.2333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0042 -10.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 -10.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4333 -10.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9875 -9.3875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4167 -10.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1375 -10.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2917 -11.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4333 -11.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4292 -11.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0042 -11.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7167 -10.6458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2708 -8.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -9.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8500 -10.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9875 -10.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6958 -8.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4125 -9.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7000 -10.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5583 -9.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5625 -10.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8375 -8.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1500 -11.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5792 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8625 -11.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -10.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0083 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2917 -10.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7250 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1417 -10.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0000 -10.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7208 -11.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1458 -9.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -9.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 15 1 0
7 20 1 0
8 1 1 0
9 26 1 0
10 13 1 0
11 1 2 0
12 3 1 0
13 12 2 0
14 33 1 0
15 22 1 0
16 8 1 0
17 8 2 0
18 6 1 0
19 6 1 0
20 19 1 0
21 18 1 0
22 24 1 0
23 17 1 0
24 16 2 0
25 10 1 0
26 27 1 0
27 25 1 0
28 7 1 0
29 9 1 0
30 9 1 0
31 4 1 0
32 5 1 0
33 30 1 0
34 29 1 0
35 36 1 0
36 31 2 0
22 23 2 0
10 5 2 0
32 35 2 0
7 21 1 0
34 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.63Molecular Weight (Monoisotopic): 488.2787AlogP: 3.55#Rotatable Bonds: 8Polar Surface Area: 57.28Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.88CX LogP: 3.49CX LogD: 2.81Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.52Np Likeness Score: -1.48
References 1. Dietrich J, Hulme C, Hurley LH.. (2010) The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796., 18 (15): [PMID:20621496 ] [10.1016/j.bmc.2010.05.063 ]