The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-chloro-3-(trifluoromethyl)phenyl)-3-(4-(2-morpholinoethoxy)naphthalen-1-yl)urea ID: ALA1213925
PubChem CID: 46919121
Max Phase: Preclinical
Molecular Formula: C24H23ClF3N3O3
Molecular Weight: 493.91
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(OCCN2CCOCC2)c2ccccc12
Standard InChI: InChI=1S/C24H23ClF3N3O3/c25-20-6-5-16(15-19(20)24(26,27)28)29-23(32)30-21-7-8-22(18-4-2-1-3-17(18)21)34-14-11-31-9-12-33-13-10-31/h1-8,15H,9-14H2,(H2,29,30,32)
Standard InChI Key: IKJIRGXOQLNWKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.9542 -16.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9583 -16.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8083 -14.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -14.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0917 -14.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3375 -14.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0500 -14.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5208 -14.3833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6667 -15.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -15.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9083 -15.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0500 -15.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -14.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -15.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -15.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2458 -17.2667 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6750 -17.2625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -17.6750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3375 -16.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3375 -14.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6583 -14.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9417 -14.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3833 -16.0167 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.7667 -16.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1958 -16.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4792 -15.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6250 -16.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9083 -14.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3417 -13.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7583 -14.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6167 -14.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3375 -15.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7625 -13.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0542 -13.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 5 1 0
5 3 1 0
6 4 2 0
7 6 1 0
8 13 1 0
9 1 2 0
10 1 1 0
11 25 1 0
12 7 2 0
13 10 2 0
14 3 2 0
15 4 1 0
16 2 1 0
17 2 1 0
18 2 1 0
19 15 2 0
20 31 1 0
21 9 1 0
22 21 2 0
23 9 1 0
24 12 1 0
25 26 1 0
26 24 1 0
27 11 1 0
28 11 1 0
29 6 1 0
30 7 1 0
31 28 1 0
32 27 1 0
33 34 1 0
34 29 2 0
13 22 1 0
19 12 1 0
30 33 2 0
32 20 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.91Molecular Weight (Monoisotopic): 493.1380AlogP: 5.87#Rotatable Bonds: 6Polar Surface Area: 62.83Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.39CX Basic pKa: 6.78CX LogP: 5.23CX LogD: 5.14Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.86
References 1. Dietrich J, Hulme C, Hurley LH.. (2010) The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796., 18 (15): [PMID:20621496 ] [10.1016/j.bmc.2010.05.063 ]