The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-tert-butyl-1-p-tolyl-1H-pyrazol-5-yl)-3-(4-methyl-3-(4-(pyridin-3-yl)pyrimidin-2-ylamino)phenyl)urea ID: ALA1213973
PubChem CID: 46919122
Max Phase: Preclinical
Molecular Formula: C31H32N8O
Molecular Weight: 532.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(C)c(Nc3nccc(-c4cccnc4)n3)c2)cc1
Standard InChI: InChI=1S/C31H32N8O/c1-20-8-12-24(13-9-20)39-28(18-27(38-39)31(3,4)5)37-30(40)34-23-11-10-21(2)26(17-23)36-29-33-16-14-25(35-29)22-7-6-15-32-19-22/h6-19H,1-5H3,(H,33,35,36)(H2,34,37,40)
Standard InChI Key: BBZXKDAPACZAMH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
16.3458 -15.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0208 -14.6708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6833 -15.1625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5958 -15.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4208 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6292 -14.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9167 -15.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6292 -15.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9208 -14.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0583 -15.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3458 -14.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2042 -15.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0250 -13.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7708 -14.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2000 -14.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6333 -15.9917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8375 -16.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4917 -14.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4875 -15.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9208 -15.9833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0583 -15.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7833 -13.5208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7458 -13.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3208 -13.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7708 -16.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2042 -15.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9250 -16.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4875 -15.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3250 -12.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7583 -12.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0458 -12.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4958 -13.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6625 -16.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1833 -17.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4333 -17.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7833 -15.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -13.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3417 -16.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0542 -11.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -14.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 4 1 0
6 1 1 0
7 6 1 0
8 11 1 0
9 8 2 0
10 14 1 0
11 10 1 0
12 9 1 0
13 2 1 0
14 19 2 0
15 7 1 0
16 8 1 0
17 5 1 0
18 12 1 0
19 15 1 0
20 7 2 0
21 10 2 0
22 32 1 0
23 13 2 0
24 13 1 0
25 28 2 0
26 27 1 0
27 16 2 0
28 19 1 0
29 24 2 0
30 23 1 0
31 30 2 0
32 18 2 0
33 17 1 0
34 17 1 0
35 17 1 0
36 18 1 0
37 40 1 0
38 21 1 0
39 31 1 0
40 36 2 0
3 5 2 0
29 31 1 0
25 21 1 0
26 12 2 0
37 22 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.65Molecular Weight (Monoisotopic): 532.2699AlogP: 7.03#Rotatable Bonds: 6Polar Surface Area: 109.65Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.41CX Basic pKa: 4.27CX LogP: 7.26CX LogD: 7.26Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.99
References 1. Dietrich J, Hulme C, Hurley LH.. (2010) The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796., 18 (15): [PMID:20621496 ] [10.1016/j.bmc.2010.05.063 ]