4-(4-(3-(3-tert-butyl-1-p-tolyl-1H-pyrazol-5-yl)ureido)phenoxy)-N-methylpicolinamide

ID: ALA1213974

PubChem CID: 11947957

Max Phase: Preclinical

Molecular Formula: C28H30N6O3

Molecular Weight: 498.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)cc2)ccn1

Standard InChI:  InChI=1S/C28H30N6O3/c1-18-6-10-20(11-7-18)34-25(17-24(33-34)28(2,3)4)32-27(36)31-19-8-12-21(13-9-19)37-22-14-15-30-23(16-22)26(35)29-5/h6-17H,1-5H3,(H,29,35)(H2,31,32,36)

Standard InChI Key:  HOHLGEPKIHZUGO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    3.7708  -22.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4458  -21.8875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1083  -22.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0208  -23.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8458  -23.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0542  -21.9583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417  -22.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0833  -23.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3667  -23.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4500  -21.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6542  -23.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2625  -23.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6250  -21.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3708  -22.3875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9458  -23.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3458  -23.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0792  -24.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2333  -23.6250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1708  -20.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7458  -20.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7958  -23.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9125  -22.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5167  -23.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6542  -21.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9417  -22.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1833  -19.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7500  -19.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4708  -19.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9125  -23.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1958  -21.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5167  -22.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1958  -23.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0875  -23.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6083  -24.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8583  -24.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5083  -23.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4792  -18.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  2  0
  5  4  1  0
  6  1  1  0
  7  6  1  0
  8  9  1  0
  9 11  2  0
 10  2  1  0
 11 15  1  0
 12  5  1  0
 13  7  1  0
 14  9  1  0
 15 18  1  0
 16  7  2  0
 17  8  2  0
 18 23  1  0
 19 10  2  0
 20 10  1  0
 21  8  1  0
 22 13  1  0
 23 32  1  0
 24 25  1  0
 25 15  2  0
 26 19  1  0
 27 20  2  0
 28 26  2  0
 29 22  1  0
 30 22  2  0
 31 30  1  0
 32 29  2  0
 33 12  1  0
 34 12  1  0
 35 12  1  0
 36 21  1  0
 37 28  1  0
  3  5  2  0
 27 28  1  0
 23 31  2  0
 14 24  2  0
M  END

Associated Targets(Human)

BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abl1 Tyrosine-protein kinase ABL (212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.59Molecular Weight (Monoisotopic): 498.2379AlogP: 5.67#Rotatable Bonds: 6
Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.48CX Basic pKa: 3.06CX LogP: 5.48CX LogD: 5.48
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.61

References

1. Dietrich J, Hulme C, Hurley LH..  (2010)  The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796.,  18  (15): [PMID:20621496] [10.1016/j.bmc.2010.05.063]

Source