The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(3-(3-tert-butyl-1-p-tolyl-1H-pyrazol-5-yl)ureido)phenoxy)-N-methylpicolinamide ID: ALA1213974
PubChem CID: 11947957
Max Phase: Preclinical
Molecular Formula: C28H30N6O3
Molecular Weight: 498.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)cc2)ccn1
Standard InChI: InChI=1S/C28H30N6O3/c1-18-6-10-20(11-7-18)34-25(17-24(33-34)28(2,3)4)32-27(36)31-19-8-12-21(13-9-19)37-22-14-15-30-23(16-22)26(35)29-5/h6-17H,1-5H3,(H,29,35)(H2,31,32,36)
Standard InChI Key: HOHLGEPKIHZUGO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
3.7708 -22.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4458 -21.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1083 -22.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0208 -23.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8458 -23.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0542 -21.9583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3417 -22.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0833 -23.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3667 -23.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4500 -21.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6542 -23.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2625 -23.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6250 -21.9667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3708 -22.3875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9458 -23.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3458 -23.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0792 -24.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2333 -23.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1708 -20.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7458 -20.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7958 -23.2208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9125 -22.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5167 -23.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6542 -21.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9417 -22.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1833 -19.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7500 -19.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4708 -19.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9125 -23.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1958 -21.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5167 -22.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1958 -23.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -23.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6083 -24.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8583 -24.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5083 -23.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4792 -18.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 4 1 0
6 1 1 0
7 6 1 0
8 9 1 0
9 11 2 0
10 2 1 0
11 15 1 0
12 5 1 0
13 7 1 0
14 9 1 0
15 18 1 0
16 7 2 0
17 8 2 0
18 23 1 0
19 10 2 0
20 10 1 0
21 8 1 0
22 13 1 0
23 32 1 0
24 25 1 0
25 15 2 0
26 19 1 0
27 20 2 0
28 26 2 0
29 22 1 0
30 22 2 0
31 30 1 0
32 29 2 0
33 12 1 0
34 12 1 0
35 12 1 0
36 21 1 0
37 28 1 0
3 5 2 0
27 28 1 0
23 31 2 0
14 24 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.59Molecular Weight (Monoisotopic): 498.2379AlogP: 5.67#Rotatable Bonds: 6Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.48CX Basic pKa: 3.06CX LogP: 5.48CX LogD: 5.48Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.61
References 1. Dietrich J, Hulme C, Hurley LH.. (2010) The design, synthesis, and evaluation of 8 hybrid DFG-out allosteric kinase inhibitors: a structural analysis of the binding interactions of Gleevec, Nexavar, and BIRB-796., 18 (15): [PMID:20621496 ] [10.1016/j.bmc.2010.05.063 ]