(S)-1-((4S,7S,13R)-13-((S)-2-amino-3-(4-hydroxyphenyl)propanamido)-7-benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-1,2-dithia-5,8,11-triazacyclotetradecane-4-carbonyl)-N-((S)-1-((S)-1-(3,5-bis(trifluoromethyl)benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-ylamino)-4-methyl-1-oxopentan-2-yl)pyrrolidine-2-carboxamide

ID: ALA1214024

PubChem CID: 49863731

Max Phase: Preclinical

Molecular Formula: C61H72F6N10O9S2

Molecular Weight: 1267.43

Molecule Type: Small molecule

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(C)(C)SSC1(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1

Standard InChI: InChI=1S/C61H72F6N10O9S2/c1-33(2)23-44(53(82)73-46(28-37-31-69-43-16-11-10-15-41(37)43)52(81)70-30-36-24-38(60(62,63)64)29-39(25-36)61(65,66)67)74-55(84)47-17-12-22-77(47)57(86)50-59(5,6)88-87-58(3,4)49(75-51(80)42(68)26-35-18-20-40(78)21-19-35)56(85)71-32-48(79)72-45(54(83)76-50)27-34-13-8-7-9-14-34/h7-11,13-16,18-21,24-25,29,31,33,42,44-47,49-50,69,78H,12,17,22-23,26-28,30,32,68H2,1-6H3,(H,70,81)(H,71,85)(H,72,79)(H,73,82)(H,74,84)(H,75,80)(H,76,83)/t42-,44-,45-,46-,47-,49+,50-/m0/s1

Standard InChI Key: PVNAJCHBKOKIIB-KKYBWPPWSA-N

Molfile:

     RDKit          2D

 88 94  0  0  0  0  0  0  0  0999 V2000
    1.0000  -12.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0000  -11.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167  -10.9167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167  -12.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875  -12.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167  -13.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3042  -12.1625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1333  -11.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4167  -10.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2833  -12.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2708   -9.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6875  -11.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875  -13.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8708  -12.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333  -12.1625    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1500  -12.5792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4208  -11.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2833  -13.4083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0208  -12.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750  -11.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8542  -11.3083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0000  -13.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7542  -10.1083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9792  -11.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2708  -10.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9917  -11.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8708  -13.8208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0792  -10.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4083  -11.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7083  -11.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625  -11.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333  -13.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6750   -9.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7125  -10.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9833  -10.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1250  -11.3333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4917   -9.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7375  -12.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2833  -10.9208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5542  -10.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2625  -11.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1292  -12.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4333  -13.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0000  -14.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0208  -13.4083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2792  -10.5042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3042  -13.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5542  -11.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042  -12.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1500  -13.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5583  -12.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7375  -11.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333  -14.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6833  -12.6000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.4042  -11.3708    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3958  -12.1833    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5625   -8.8750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2667   -8.4667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.9875   -8.8833    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0125  -10.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8375  -11.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0208  -10.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4542  -12.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875  -10.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167  -15.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0208  -10.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3042  -11.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875  -10.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3125   -9.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1667  -10.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6875  -13.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1417  -13.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4583  -11.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2875  -11.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8708   -9.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9042  -10.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667   -8.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2708  -12.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042   -8.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292  -14.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7125  -15.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792  -12.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667  -13.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6792   -7.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4958   -7.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292  -16.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1458  -15.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500  -15.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  6
  3  2  1  0
  4  1  1  0
  5 14  1  0
  6  4  1  0
  5  7  1  1
 17  8  1  1
  9 34  1  0
 10  1  1  0
 11 25  1  0
 12 24  1  0
  5 13  1  0
 14 16  1  0
 15 10  1  0
 16 15  1  0
 17  3  1  0
 18 22  1  0
 19  7  1  0
 20 31  1  0
 21  8  1  0
 22  6  1  0
 23 28  1  0
 24 41  1  0
 25 40  2  0
 26 20  1  0
 27 13  1  0
 28  9  2  0
 29 30  1  0
 30 26  1  1
 31 21  1  6
 32 18  1  0
 33  9  1  0
 30 34  1  0
 35 25  1  0
 36 29  1  0
 37 33  2  0
 38 19  1  0
 39  2  2  0
 40 48  1  0
 41 48  2  0
 42  8  2  0
 43  6  2  0
 22 44  1  6
 45 19  2  0
 46 20  2  0
 47 13  2  0
 48 61  1  0
 49 29  2  0
 50 32  1  0
 31 51  1  0
 38 52  1  0
 53 32  2  0
 54 12  1  0
 55 12  1  0
 56 12  1  0
 57 11  1  0
 58 11  1  0
 59 11  1  0
 60  3  1  0
 61 36  1  0
 62 52  1  0
 38 63  1  1
 64 69  1  0
 65 44  1  0
 66 62  1  0
 67 62  2  0
 68 67  1  0
 69 66  2  0
 70 17  1  0
 71 10  1  0
 72 10  1  0
 73 14  1  0
 74 14  1  0
 75 64  1  0
 76 60  1  0
 77 33  1  0
 78 51  1  0
 79 37  1  0
 80 65  1  0
 81 65  2  0
 82 78  1  0
 83 78  1  0
 84 77  2  0
 85 84  1  0
 86 81  1  0
 87 80  2  0
 88 87  1  0
 70 76  1  0
 50 27  1  0
 88 86  2  0
 64 68  2  0
 23 37  1  0
 85 79  2  0
 35 24  2  0
M  END

Associated Targets(Human)

OPRD1 Tclin Delta opioid receptor (15096 Activities)

Discover Target: OPRD1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)

Discover Target: TACR1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Associated Targets(non-human)

Oprm1 Mu opioid receptor (6060 Activities)

Discover Target: Oprm1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Tacr2 Neurokinin 2 receptor (373 Activities)

Discover Target: Tacr2

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Plasma (10718 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

TACR1 Neurokinin 1 receptor (881 Activities)

Discover Target: TACR1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Oprd1 Delta opioid receptor (3127 Activities)

Discover Target: Oprd1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

OPRM1 Mu opioid receptor (3620 Activities)

Discover Target: OPRM1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1267.43	Molecular Weight (Monoisotopic): 1266.4829	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Yamamoto T, Nair P, Jacobsen NE, Kulkarni V, Davis P, Ma SW, Navratilova E, Yamamura HI, Vanderah TW, Porreca F, Lai J, Hruby VJ.. (2010) Biological and conformational evaluation of bifunctional compounds for opioid receptor agonists and neurokinin 1 receptor antagonists possessing two penicillamines., 53 (15): [PMID:20617791] [10.1021/jm100157m]

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source