(S)-benzyl 1-(2-(4-methoxybenzoyloxyamino)-2-oxoethylamino)-1-oxo-3-phenylpropan-2-ylcarbamate

ID: ALA1221693

PubChem CID: 49864402

Max Phase: Preclinical

Molecular Formula: C27H27N3O7

Molecular Weight: 505.53

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)ONC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)cc1

Standard InChI:  InChI=1S/C27H27N3O7/c1-35-22-14-12-21(13-15-22)26(33)37-30-24(31)17-28-25(32)23(16-19-8-4-2-5-9-19)29-27(34)36-18-20-10-6-3-7-11-20/h2-15,23H,16-18H2,1H3,(H,28,32)(H,29,34)(H,30,31)/t23-/m0/s1

Standard InChI Key:  MWMGBOYXKWUFNQ-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   -0.3171   -0.6990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3976   -0.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8239   -0.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5394   -0.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9654   -0.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6843   -0.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3998   -0.6993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1145   -0.2834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8299   -0.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3976    0.5408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5394   -1.5235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8239    0.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5394    0.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5339    1.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2518    2.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9707    1.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9671    0.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2518    0.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0322   -0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7444   -0.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4559   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1677   -0.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1652   -1.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4451   -1.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7362   -1.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6854    0.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8289   -1.5197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5430   -0.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2570   -0.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9703   -0.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9709    0.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2523    0.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5419    0.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6841    0.9508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3982    0.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1109   -0.6975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2524   -0.2839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  2  0
 18 13  1  0
  1 19  1  0
  1  2  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
  3  4  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  5  6  1  0
  6 26  2  0
  6  7  1  0
  9 27  2  0
  7  8  1  0
  8  9  1  0
 28 29  2  0
  2 10  2  0
 29 30  1  0
  4 11  2  0
 30 31  2  0
  3 12  1  1
 31 32  1  0
 12 13  1  0
 32 33  2  0
 33 28  1  0
  9 28  1  0
 13 14  2  0
 31 34  1  0
 14 15  1  0
 34 35  1  0
 15 16  2  0
 16 17  1  0
  2 36  1  0
 36  3  1  0
  4 37  1  0
 37  5  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1221693

   Z-FG-NHO-BzOME

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 505.53

Molecular Weight (Monoisotopic): 505.1849

AlogP: 2.54

#Rotatable Bonds: 10

Polar Surface Area: 132.06

Molecular Species: NEUTRAL

HBA: 7

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.11

CX Basic pKa: ┄

CX LogP: 3.36

CX LogD: 3.36

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.36

Np Likeness Score: -0.47

References

1. Kato D, Boatright KM, Berger AB, Nazif T, Blum G, Ryan C, Chehade KA, Salvesen GS, Bogyo M..  (2005)  Activity-based probes that target diverse cysteine protease families.,  1  (1): [PMID:16407991] [10.1038/nchembio707]

2. Okada K, Ye YQ, Taniguchi K, Yoshida A, Akiyama T, Yoshioka Y, Onose J, Koshino H, Takahashi S, Yajima A, Abe N, Yajima S..  (2013)  Vialinin A is a ubiquitin-specific peptidase inhibitor.,  23  (15): [PMID:23791076] [10.1016/j.bmcl.2013.05.093]

Source

Source(1):

• Scientific Literature