(S)-3-((S)-2-(benzyloxycarbonylamino)-3-phenylpropanamido)-6-guanidino-2-oxohexyl 2,6-dimethylbenzoate

ID: ALA1221749

PubChem CID: 643625

Max Phase: Preclinical

Molecular Formula: C33H39N5O6

Molecular Weight: 601.70

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1C(=O)OCC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C33H39N5O6/c1-22-11-9-12-23(2)29(22)31(41)43-21-28(39)26(17-10-18-36-32(34)35)37-30(40)27(19-24-13-5-3-6-14-24)38-33(42)44-20-25-15-7-4-8-16-25/h3-9,11-16,26-27H,10,17-21H2,1-2H3,(H,37,40)(H,38,42)(H4,34,35,36)/t26-,27-/m0/s1

Standard InChI Key:  AHCLHJFPKBHMDV-SVBPBHIXSA-N

Molfile:  

     RDKit          2D

 44 46  0  0  0  0  0  0  0  0999 V2000
   15.8921  -12.7161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6077  -12.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0335  -12.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7497  -12.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1757  -12.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8954  -12.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6116  -12.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3271  -12.3009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0434  -12.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6077  -11.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7497  -13.5423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0335  -11.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7497  -11.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7442  -10.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4629   -9.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1826  -10.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1791  -11.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4630  -11.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1762  -12.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4632  -12.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7510  -12.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0384  -12.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0409  -13.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7618  -13.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4714  -13.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8964  -11.4755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0423  -13.5387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7573  -12.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4719  -12.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1860  -12.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1866  -11.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4672  -11.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7561  -11.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4709  -13.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0406  -11.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1747  -13.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8886  -13.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8876  -14.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6016  -15.1937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6005  -16.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3145  -16.4321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8855  -16.4303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3205  -12.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4627  -12.3018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 20 21  2  0
 21 22  1  0
  3  4  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  5  6  1  0
  6 26  2  0
  6  7  1  0
  9 27  2  0
  7  8  1  0
  8  9  1  0
 28 29  2  0
  2 10  2  0
 29 30  1  0
  4 11  2  0
 30 31  2  0
  3 12  1  1
 31 32  1  0
 12 13  1  0
 32 33  2  0
 33 28  1  0
  9 28  1  0
 13 14  2  0
 29 34  1  0
 14 15  1  0
 33 35  1  0
 15 16  2  0
  5 36  1  6
 16 17  1  0
 36 37  1  0
 17 18  2  0
 37 38  1  0
 18 13  1  0
 38 39  1  0
 39 40  1  0
  1 19  1  0
 40 41  1  0
  1  2  1  0
 40 42  2  0
 19 20  1  0
 43  3  1  0
  2 43  1  0
  4 44  1  0
 44  5  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1221749

   Z-FR-AMOK 9b

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 601.70

Molecular Weight (Monoisotopic): 601.2900

AlogP: 3.32

#Rotatable Bonds: 15

Polar Surface Area: 172.70

Molecular Species: BASE

HBA: 7

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 12.51

CX Basic pKa: 11.84

CX LogP: 4.51

CX LogD: 2.42

Aromatic Rings: 3

Heavy Atoms: 44

QED Weighted: 0.08

Np Likeness Score: -0.12

References

1. Kato D, Boatright KM, Berger AB, Nazif T, Blum G, Ryan C, Chehade KA, Salvesen GS, Bogyo M..  (2005)  Activity-based probes that target diverse cysteine protease families.,  1  (1): [PMID:16407991] [10.1038/nchembio707]

2. Dechert AM, MacNamara JP, Breevoort SR, Hildebrandt ER, Hembree NW, Rea AC, McLain DE, Porter SB, Schmidt WK, Dore TM..  (2010)  Modulation of the inhibitor properties of dipeptidyl (acyloxy)methyl ketones toward the CaaX proteases.,  18  (17): [PMID:20696584] [10.1016/j.bmc.2010.07.041]

Source

Source(1):

• Scientific Literature