(S)-3-(2-(benzyloxycarbonylamino)-4-methylpentanamido)-2-oxopropyl 2,6-dimethylbenzoate

ID: ALA1221750

PubChem CID: 643624

Max Phase: Preclinical

Molecular Formula: C26H32N2O6

Molecular Weight: 468.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1C(=O)OCC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C26H32N2O6/c1-17(2)13-22(28-26(32)34-15-20-11-6-5-7-12-20)24(30)27-14-21(29)16-33-25(31)23-18(3)9-8-10-19(23)4/h5-12,17,22H,13-16H2,1-4H3,(H,27,30)(H,28,32)/t22-/m0/s1

Standard InChI Key:  ZDNOFEXGJCMHBV-QFIPXVFZSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   -1.1120  -17.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3965  -16.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0293  -16.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7455  -17.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1716  -17.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912  -16.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6075  -17.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3229  -16.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0392  -17.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3965  -16.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7455  -18.1214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0293  -16.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7455  -15.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8280  -16.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5410  -17.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2532  -16.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9657  -17.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9633  -18.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2423  -18.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5327  -18.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8922  -16.0545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0382  -18.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7531  -16.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4678  -17.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1818  -16.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1825  -16.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4631  -15.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7519  -16.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4668  -18.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0364  -15.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4615  -16.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7426  -14.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3163  -17.2941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4585  -16.8810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  3  4  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5  6  1  0
  6 21  2  0
  6  7  1  0
  9 22  2  0
  7  8  1  0
  8  9  1  0
 23 24  2  0
  2 10  2  0
 24 25  1  0
  4 11  2  0
 25 26  2  0
  3 12  1  1
 26 27  1  0
 12 13  1  0
 27 28  2  0
 28 23  1  0
  9 23  1  0
 24 29  1  0
  1 14  1  0
 28 30  1  0
  1  2  1  0
 13 31  1  0
 14 15  1  0
 13 32  1  0
 15 16  2  0
 33  3  1  0
  2 33  1  0
  4 34  1  0
 34  5  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1221750

   Z-LG-AOMK 9c

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 468.55

Molecular Weight (Monoisotopic): 468.2260

AlogP: 3.49

#Rotatable Bonds: 11

Polar Surface Area: 110.80

Molecular Species: NEUTRAL

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.71

CX Basic pKa: ┄

CX LogP: 4.77

CX LogD: 4.77

Aromatic Rings: 2

Heavy Atoms: 34

QED Weighted: 0.49

Np Likeness Score: -0.35

References

1. Kato D, Boatright KM, Berger AB, Nazif T, Blum G, Ryan C, Chehade KA, Salvesen GS, Bogyo M..  (2005)  Activity-based probes that target diverse cysteine protease families.,  1  (1): [PMID:16407991] [10.1038/nchembio707]

Source

Source(1):

• Scientific Literature