3-((S)-2-((S)-2-acetamido-3-(4-hydroxyphenyl)propanamido)-3-phenylpropanamido)-2-oxopropyl 2,6-dimethylbenzoate

ID: ALA1221751

PubChem CID: 643626

Max Phase: Preclinical

Molecular Formula: C32H35N3O7

Molecular Weight: 573.65

Molecule Type: Protein

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)COC(=O)c1c(C)cccc1C

Standard InChI:  InChI=1S/C32H35N3O7/c1-20-8-7-9-21(2)29(20)32(41)42-19-26(38)18-33-30(39)27(16-23-10-5-4-6-11-23)35-31(40)28(34-22(3)36)17-24-12-14-25(37)15-13-24/h4-15,27-28,37H,16-19H2,1-3H3,(H,33,39)(H,34,36)(H,35,40)/t27-,28-/m0/s1

Standard InChI Key:  JEVSEWLAYFRUAI-NSOVKSMOSA-N

Molfile:  

     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   -3.9216   -0.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5091   -1.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6837   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2715   -2.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6849   -2.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5137   -2.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9220   -2.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2709   -0.7133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4464   -0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0337   -1.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2092   -1.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0342    0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4464    0.7148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2087    0.0007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2036    0.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0291    0.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4419   -0.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6837    0.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2714    0.7157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1996   -2.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0210   -2.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4335   -1.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0187   -0.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1986   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5090    0.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9213    0.7157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7459    0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1586    1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1582    0.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2724   -3.5700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4413    1.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2669    1.4288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6791    2.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2669    2.8568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5046    2.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9160    1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7438    1.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1586    2.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7402    2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9133    2.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5035    0.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5008    3.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  9  8  1  6
  9 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
  8 18  1  0
 18 19  2  0
 11 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 11  1  0
 18 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 25  1  1  6
  5 30  1  0
 16 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 36 41  1  0
 40 42  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1221751

   AC-YFG-AMOK 10a

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Protein

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 573.65

Molecular Weight (Monoisotopic): 573.2475

AlogP: 2.33

#Rotatable Bonds: 13

Polar Surface Area: 150.90

Molecular Species: NEUTRAL

HBA: 7

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 9.50

CX Basic pKa: ┄

CX LogP: 3.64

CX LogD: 3.64

Aromatic Rings: 3

Heavy Atoms: 42

QED Weighted: 0.23

Np Likeness Score: -0.06

References

1. Kato D, Boatright KM, Berger AB, Nazif T, Blum G, Ryan C, Chehade KA, Salvesen GS, Bogyo M..  (2005)  Activity-based probes that target diverse cysteine protease families.,  1  (1): [PMID:16407991] [10.1038/nchembio707]

2. Dechert AM, MacNamara JP, Breevoort SR, Hildebrandt ER, Hembree NW, Rea AC, McLain DE, Porter SB, Schmidt WK, Dore TM..  (2010)  Modulation of the inhibitor properties of dipeptidyl (acyloxy)methyl ketones toward the CaaX proteases.,  18  (17): [PMID:20696584] [10.1016/j.bmc.2010.07.041]

Source

Source(1):

• Scientific Literature