The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
CRC-220 ID: ALA1231689
Cas Number: 146663-95-8
PubChem CID: 177837
Max Phase: Preclinical
Molecular Formula: C29H39N5O7S
Molecular Weight: 601.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C)c(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](Cc2ccc(C(=N)N)cc2)C(=O)N2CCCCC2)c(C)c1C
Standard InChI: InChI=1S/C29H39N5O7S/c1-17-14-24(41-4)18(2)19(3)26(17)42(39,40)33-22(16-25(35)36)28(37)32-23(29(38)34-12-6-5-7-13-34)15-20-8-10-21(11-9-20)27(30)31/h8-11,14,22-23,33H,5-7,12-13,15-16H2,1-4H3,(H3,30,31)(H,32,37)(H,35,36)/t22-,23+/m0/s1
Standard InChI Key: ZOXOKTJHZSUHRJ-XZOQPEGZSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
0.8828 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 3.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 3.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 3.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2606 3.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2606 4.2958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9750 3.0583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 0.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 0.5833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3118 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3118 -0.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0263 0.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7407 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4552 0.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4552 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7407 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0263 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 -1.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 -1.8917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.9586 -1.1773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1336 -2.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2606 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2606 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9750 -3.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6895 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6895 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9750 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 -3.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9750 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9750 -1.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4040 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4040 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 -0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 0.9958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2606 0.9958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 -0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 -0.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
10 1 1 0
2 3 1 0
3 6 2 0
4 5 2 0
6 4 1 0
6 7 1 0
7 8 1 0
7 9 2 0
11 10 1 0
11 12 1 6
11 13 1 0
41 12 1 0
13 14 2 0
13 15 1 0
16 15 1 0
20 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 1 0
36 21 1 1
23 22 2 0
24 22 2 0
25 22 1 0
25 26 2 0
25 30 1 0
26 27 1 0
26 31 1 0
27 28 2 0
27 32 1 0
28 29 1 0
28 34 1 0
29 30 2 0
33 30 1 0
35 34 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 2 0
38 40 1 0
41 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.73Molecular Weight (Monoisotopic): 601.2570AlogP: 1.77#Rotatable Bonds: 12Polar Surface Area: 191.98Molecular Species: ZWITTERIONHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.69CX Basic pKa: 11.47CX LogP: 0.48CX LogD: 0.48Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: -0.48
References 1. Eckhardt U, Schroeder A, Stieger B, Höchli M, Landmann L, Tynes R, Meier PJ, Hagenbuch B.. (1999) Polyspecific substrate uptake by the hepatic organic anion transporter Oatp1 in stably transfected CHO cells., 276 (1): [PMID:10198348 ] [10.1152/ajpgi.1999.276.4.g1037 ] 2. Kontaxi M, Echkardt U, Hagenbuch B, Stieger B, Meier PJ, Petzinger E.. (1996) Uptake of the mycotoxin ochratoxin A in liver cells occurs via the cloned organic anion transporting polypeptide., 279 (1): [PMID:8968376 ]