The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-({7-Chloro-2-[4-(2-hydroxy-ethyl)-piperazin-1-ylmethyl]-3-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl}-prop-2-ynyl-amino)-N-pyridin-3-ylmethyl-benzamide ID: ALA123191
PubChem CID: 10416346
Max Phase: Preclinical
Molecular Formula: C33H36ClN7O3
Molecular Weight: 614.15
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1cc2c(=O)n(C)c(CN3CCN(CCO)CC3)nc2cc1Cl)c1ccc(C(=O)NCc2cccnc2)cc1
Standard InChI: InChI=1S/C33H36ClN7O3/c1-3-11-41(27-8-6-25(7-9-27)32(43)36-21-24-5-4-10-35-20-24)22-26-18-28-30(19-29(26)34)37-31(38(2)33(28)44)23-40-14-12-39(13-15-40)16-17-42/h1,4-10,18-20,42H,11-17,21-23H2,2H3,(H,36,43)
Standard InChI Key: DHPUTTPWWGKHLP-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
-1.1333 -2.0750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4250 -1.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2875 -2.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4250 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2875 -2.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -1.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7125 -2.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -1.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8500 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8500 -4.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 -2.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8417 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -5.7792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5500 -0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -1.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4250 -0.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6042 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9625 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6417 -2.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2625 -0.3875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1875 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 -1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 -1.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -2.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8500 -1.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5583 -4.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -4.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4250 -3.3042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.1292 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5542 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8500 -6.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -7.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9875 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2792 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -7.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9917 -1.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 2 0
6 5 1 0
7 8 1 0
8 4 2 0
9 6 2 0
10 21 1 0
11 9 1 0
12 7 1 0
13 3 1 0
14 13 1 0
15 12 1 0
16 37 1 0
17 34 1 0
18 16 3 0
19 10 1 0
20 2 2 0
21 26 2 0
22 15 1 0
23 10 2 0
24 38 2 0
25 27 2 0
26 28 1 0
27 22 1 0
28 22 2 0
29 30 1 0
30 19 1 0
31 1 1 0
32 14 1 0
33 14 1 0
34 33 1 0
35 32 1 0
36 11 1 0
37 15 1 0
38 29 1 0
39 17 1 0
40 43 1 0
41 44 2 0
42 29 2 0
43 39 1 0
44 42 1 0
6 4 1 0
17 35 1 0
11 7 2 0
25 21 1 0
41 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 614.15Molecular Weight (Monoisotopic): 613.2568AlogP: 2.66#Rotatable Bonds: 11Polar Surface Area: 106.83Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.40CX LogP: 2.29CX LogD: 1.99Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.25Np Likeness Score: -1.69
References 1. Bavetsias V, Skelton LA, Yafai F, Mitchell F, Wilson SC, Allan B, Jackman AL.. (2002) The design and synthesis of water-soluble analogues of CB30865, a quinazolin-4-one-based antitumor agent., 45 (17): [PMID:12166942 ] [10.1021/jm011081s ]