The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Estrone-3-glucuronide ID: ALA1232444
Cas Number: 2479-90-5
PubChem CID: 115255
Max Phase: Preclinical
Molecular Formula: C24H30O8
Molecular Weight: 446.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4ccc(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)cc4CC[C@H]3[C@@H]1CCC2=O
Standard InChI: InChI=1S/C24H30O8/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-16,18-21,23,26-28H,2,4,6-9H2,1H3,(H,29,30)/t14-,15-,16+,18+,19+,20-,21+,23-,24+/m1/s1
Standard InChI Key: FJAZVHYPASAQKM-JBAURARKSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.0806 0.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5488 0.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8291 1.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6412 1.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1731 1.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9852 1.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1042 -1.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7079 -1.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9882 -0.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4564 0.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 -0.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8875 0.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6997 0.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9800 -0.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4481 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6360 -0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7284 -1.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5406 -1.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0724 -1.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7921 -0.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4434 -0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1262 -0.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -1.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4322 -2.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7367 0.8122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2973 2.3641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9215 2.6545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5170 0.7624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2655 2.1690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8928 0.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8003 -0.4492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4033 -1.9450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5525 0.4264 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8035 -1.7945 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6246 0.3652 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 30 1 0
1 31 1 1
2 3 1 0
2 25 1 6
3 4 1 0
3 26 1 1
4 5 1 0
4 27 1 6
5 6 1 1
5 30 1 0
6 28 2 0
6 29 1 0
7 8 2 0
7 16 1 0
8 9 1 0
9 10 2 0
9 31 1 0
10 11 1 0
11 12 1 0
16 11 2 0
12 13 1 0
14 13 1 0
14 15 1 0
20 14 1 0
16 15 1 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 23 1 0
19 24 1 1
20 21 1 0
21 22 1 0
22 23 1 0
23 32 2 0
20 33 1 6
15 34 1 6
14 35 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1941AlogP: 1.38#Rotatable Bonds: 3Polar Surface Area: 133.52Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.30CX Basic pKa: ┄CX LogP: 2.36CX LogD: -1.06Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: 1.99
References 1. Bossuyt X, Müller M, Hagenbuch B, Meier PJ.. (1996) Polyspecific drug and steroid clearance by an organic anion transporter of mammalian liver., 276 (1): [PMID:8786566 ] 2. Tamai I, Nozawa T, Koshida M, Nezu J, Sai Y, Tsuji A.. (2001) Functional characterization of human organic anion transporting polypeptide B (OATP-B) in comparison with liver-specific OATP-C., 18 (1): [PMID:11683238 ] [10.1023/a:1013077609227 ]