Estrone-3-glucuronide

ID: ALA1232444

Cas Number: 2479-90-5

PubChem CID: 115255

Max Phase: Preclinical

Molecular Formula: C24H30O8

Molecular Weight: 446.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@@H]3c4ccc(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)cc4CC[C@H]3[C@@H]1CCC2=O

Standard InChI:  InChI=1S/C24H30O8/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-16,18-21,23,26-28H,2,4,6-9H2,1H3,(H,29,30)/t14-,15-,16+,18+,19+,20-,21+,23-,24+/m1/s1

Standard InChI Key:  FJAZVHYPASAQKM-JBAURARKSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    2.0806    0.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5488    0.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8291    1.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6412    1.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1731    1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9852    1.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1042   -1.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7079   -1.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9882   -0.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564    0.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557   -0.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8875    0.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6997    0.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9800   -0.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4481   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6360   -0.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7284   -1.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5406   -1.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0724   -1.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7921   -0.5445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4434   -0.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1262   -0.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8969   -1.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4322   -2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7367    0.8122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2973    2.3641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9215    2.6545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5170    0.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2655    2.1690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8928    0.4720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8003   -0.4492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4033   -1.9450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5525    0.4264    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8035   -1.7945    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6246    0.3652    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 30  1  0
  1 31  1  1
  2  3  1  0
  2 25  1  6
  3  4  1  0
  3 26  1  1
  4  5  1  0
  4 27  1  6
  5  6  1  1
  5 30  1  0
  6 28  2  0
  6 29  1  0
  7  8  2  0
  7 16  1  0
  8  9  1  0
  9 10  2  0
  9 31  1  0
 10 11  1  0
 11 12  1  0
 16 11  2  0
 12 13  1  0
 14 13  1  0
 14 15  1  0
 20 14  1  0
 16 15  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 23  1  0
 19 24  1  1
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 32  2  0
 20 33  1  6
 15 34  1  6
 14 35  1  1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

SLCO1B1 Tchem Solute carrier organic anion transporter family member 1B1 (2672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Slco1a1 Solute carrier organic anion transporter family member 1A1 (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1941AlogP: 1.38#Rotatable Bonds: 3
Polar Surface Area: 133.52Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.30CX Basic pKa: CX LogP: 2.36CX LogD: -1.06
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: 1.99

References

1. Bossuyt X, Müller M, Hagenbuch B, Meier PJ..  (1996)  Polyspecific drug and steroid clearance by an organic anion transporter of mammalian liver.,  276  (1): [PMID:8786566]
2. Tamai I, Nozawa T, Koshida M, Nezu J, Sai Y, Tsuji A..  (2001)  Functional characterization of human organic anion transporting polypeptide B (OATP-B) in comparison with liver-specific OATP-C.,  18  (1): [PMID:11683238] [10.1023/a:1013077609227]